![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | canva_blank.svg | 2023-12-05 09:50 | 62 | |
![[IMG]](/icons/image2.gif) | canva_grid.png | 2023-12-05 09:50 | 79 | |
![[IMG]](/icons/image2.gif) | Polygon-green2-bottom-left.svg | 2024-03-08 12:52 | 161 | |
![[IMG]](/icons/image2.gif) | Polygon-green-big.svg | 2024-03-08 12:52 | 164 | |
![[IMG]](/icons/image2.gif) | Polygon-big.svg | 2024-03-08 12:52 | 167 | |
![[IMG]](/icons/image2.gif) | Rectangle--green-bottom-left.svg | 2024-03-08 12:52 | 167 | |
![[IMG]](/icons/image2.gif) | Rectangle--yellow-bottom-left.svg | 2024-03-08 12:52 | 167 | |
![[IMG]](/icons/image2.gif) | Rectangle--green-top-right.svg | 2024-03-08 12:52 | 175 | |
![[IMG]](/icons/image2.gif) | Rectangle--yellow-top-right.svg | 2024-03-08 12:52 | 176 | |
![[IMG]](/icons/image2.gif) | Rectangle--green-top-left.svg | 2024-03-08 12:52 | 177 | |
![[IMG]](/icons/image2.gif) | Rectangle--yellow-top-left.svg | 2024-03-08 12:52 | 177 | |
![[IMG]](/icons/image2.gif) | Rectangle--blue-top-left.svg | 2024-03-08 12:52 | 178 | |
![[IMG]](/icons/image2.gif) | union-minus.svg | 2024-03-08 12:52 | 179 | |
![[IMG]](/icons/image2.gif) | canva_header-bg.png | 2023-12-05 09:50 | 180 | |
![[IMG]](/icons/image2.gif) | Polygon--blue-bottom-right.svg | 2024-03-08 12:52 | 204 | |
![[IMG]](/icons/image2.gif) | Polygon-green-bottom-right.svg | 2024-03-08 12:52 | 204 | |
![[IMG]](/icons/image2.gif) | Polygon-blue-top-left.svg | 2024-03-08 12:52 | 210 | |
![[IMG]](/icons/image2.gif) | Polygon-yellow-top-right.svg | 2024-03-08 12:52 | 210 | |
![[IMG]](/icons/image2.gif) | Rectangle--blue-top-right.svg | 2024-03-08 12:52 | 218 | |
![[IMG]](/icons/image2.gif) | play-icon.svg | 2024-03-08 12:52 | 222 | |
![[IMG]](/icons/image2.gif) | Rectangle--blue-bottom-left.svg | 2024-03-08 12:52 | 224 | |
![[IMG]](/icons/image2.gif) | icon-play.svg | 2024-03-08 12:52 | 225 | |
![[IMG]](/icons/image2.gif) | icon-plus.svg | 2024-03-08 12:52 | 234 | |
![[IMG]](/icons/image2.gif) | Polygon-yellow-top-left.svg | 2024-03-08 12:52 | 236 | |
![[IMG]](/icons/image2.gif) | Polygon-green-bright-bottom-left.svg | 2024-03-08 12:52 | 260 | |
![[TXT]](/icons/text.gif) | canva_custom.css | 2023-12-05 09:50 | 270 | |
![[IMG]](/icons/image2.gif) | pause-icon.svg | 2024-03-08 12:52 | 270 | |
![[IMG]](/icons/image2.gif) | union-plus.svg | 2024-03-08 12:52 | 274 | |
![[IMG]](/icons/image2.gif) | quote.svg | 2024-03-08 12:52 | 300 | |
![[IMG]](/icons/image2.gif) | select-arrow.svg | 2024-03-08 12:52 | 515 | |
![[IMG]](/icons/image2.gif) | icon-course.svg | 2024-03-08 12:52 | 559 | |
![[IMG]](/icons/image2.gif) | 1-1.png | 2023-12-05 09:49 | 567 | |
![[IMG]](/icons/image2.gif) | tick2-25x23.png | 2023-12-05 09:50 | 579 | |
![[TXT]](/icons/text.gif) | canva_font-icons-rtl.css | 2023-12-05 09:50 | 582 | |
![[IMG]](/icons/image2.gif) | icon-union.svg | 2024-03-08 12:52 | 595 | |
![[IMG]](/icons/image2.gif) | icon-tiles.svg | 2024-03-08 12:52 | 639 | |
![[IMG]](/icons/image2.gif) | icon-search.svg | 2024-03-08 12:52 | 640 | |
![[IMG]](/icons/image2.gif) | canva_svg-icon.svg | 2023-12-05 09:50 | 658 | |
![[TXT]](/icons/text.gif) | canva_font-icons-snapchat.css | 2023-12-05 09:50 | 695 | |
![[IMG]](/icons/image2.gif) | vimeo-play.png | 2023-12-05 09:50 | 733 | |
![[TXT]](/icons/text.gif) | canva_content.css | 2023-12-05 09:50 | 762 | |
![[IMG]](/icons/image2.gif) | x2-19x20.png | 2023-12-05 09:50 | 764 | |
![[IMG]](/icons/image2.gif) | 4-2.png | 2023-12-05 09:50 | 771 | |
![[IMG]](/icons/image2.gif) | favicon-16x16-1.png | 2024-03-08 12:52 | 781 | |
![[IMG]](/icons/image2.gif) | favicon-16x16.png | 2025-02-20 15:43 | 781 | |
![[TXT]](/icons/text.gif) | canva_colors-rtl.css | 2023-12-05 09:50 | 802 | |
![[TXT]](/icons/text.gif) | canva_faqs.css | 2023-12-05 09:50 | 851 | |
![[IMG]](/icons/image2.gif) | 1-1-35x35.png | 2023-12-05 09:49 | 853 | |
![[IMG]](/icons/image2.gif) | canva_logo-dark.png | 2023-12-05 09:50 | 872 | |
![[IMG]](/icons/image2.gif) | 7.png | 2023-12-05 09:50 | 930 | |
![[IMG]](/icons/image2.gif) | 1-1-32x41.png | 2023-12-05 09:49 | 945 | |
![[TXT]](/icons/text.gif) | canva_style-import.css | 2023-12-05 09:50 | 969 | |
![[IMG]](/icons/image2.gif) | cao.png | 2023-12-05 09:50 | 1.0K | |
![[TXT]](/icons/text.gif) | canva_jquery.countto.js | 2023-12-05 09:50 | 1.0K | |
![[TXT]](/icons/text.gif) | canva_jquery.textrotator.js | 2023-12-05 09:50 | 1.0K | |
![[IMG]](/icons/image2.gif) | 2.png | 2023-12-05 09:49 | 1.0K | |
![[IMG]](/icons/image2.gif) | canva_footer-logo.png | 2023-12-05 09:50 | 1.0K | |
![[IMG]](/icons/image2.gif) | canva_footer-widget-logo.png | 2023-12-05 09:50 | 1.0K | |
![[IMG]](/icons/image2.gif) | 5-1.png | 2023-12-05 09:50 | 1.0K | |
![[TXT]](/icons/text.gif) | canva_shortcodes.css | 2023-12-05 09:50 | 1.1K | |
![[IMG]](/icons/image2.gif) | 6-1.png | 2023-12-05 09:50 | 1.1K | |
![[IMG]](/icons/image2.gif) | 3-2.png | 2023-12-05 09:50 | 1.2K | |
![[TXT]](/icons/text.gif) | canva_intro-fonts.css | 2023-12-05 09:50 | 1.2K | |
![[TXT]](/icons/text.gif) | canva_jquery.cookie.js | 2023-12-05 09:50 | 1.4K | |
![[TXT]](/icons/text.gif) | canva_youtubebg.css | 2023-12-05 09:50 | 1.4K | |
![[ ]](/icons/unknown.gif) | icomoon.ttf | 2025-03-19 09:44 | 1.4K | |
![[IMG]](/icons/image2.gif) | 18 Computer-100x100.png | 2023-12-05 09:49 | 1.5K | |
![[TXT]](/icons/text.gif) | canva_process-steps.css | 2023-12-05 09:50 | 1.5K | |
![[ ]](/icons/unknown.gif) | icomoon.woff | 2025-03-19 09:44 | 1.5K | |
![[TXT]](/icons/text.gif) | canva_clients.css | 2023-12-05 09:50 | 1.5K | |
![[IMG]](/icons/image2.gif) | canva_logo-dark@2x.png | 2023-12-05 09:50 | 1.6K | |
![[ ]](/icons/unknown.gif) | icomoon.eot | 2025-03-19 09:44 | 1.6K | |
![[TXT]](/icons/text.gif) | canva_alerts.css | 2023-12-05 09:50 | 1.6K | |
![[TXT]](/icons/text.gif) | canva_jquery.flickrfeed.js | 2023-12-05 09:50 | 1.7K | |
![[IMG]](/icons/image2.gif) | registry-sidebar-thumb-2.jpg | 2023-12-05 09:50 | 1.7K | |
![[IMG]](/icons/image2.gif) | physio-73x72.jpg | 2023-12-05 09:50 | 1.8K | |
![[IMG]](/icons/image2.gif) | 2-35x35.png | 2023-12-05 09:49 | 1.9K | |
![[IMG]](/icons/image2.gif) | favicon-32x32-1.png | 2024-03-08 12:52 | 1.9K | |
![[IMG]](/icons/image2.gif) | favicon-32x32.png | 2025-02-20 15:43 | 1.9K | |
![[IMG]](/icons/image2.gif) | 2-32x39.png | 2023-12-05 09:49 | 1.9K | |
![[IMG]](/icons/image2.gif) | icomoon.svg | 2025-03-19 09:44 | 1.9K | |
![[IMG]](/icons/image2.gif) | Cal05_Anatomy_30-73x72.JPG | 2023-12-05 09:50 | 2.0K | |
![[TXT]](/icons/text.gif) | canva_jquery.fitvids.js | 2023-12-05 09:50 | 2.0K | |
![[IMG]](/icons/image2.gif) | canva_footer-logo@2x.png | 2023-12-05 09:50 | 2.0K | |
![[IMG]](/icons/image2.gif) | canva_footer-widget-logo@2x.png | 2023-12-05 09:50 | 2.0K | |
![[IMG]](/icons/image2.gif) | 11 Your Student Record-100x100.png | 2023-12-05 09:49 | 2.0K | |
![[IMG]](/icons/image2.gif) | phone.png | 2023-12-05 09:50 | 2.1K | |
![[IMG]](/icons/image2.gif) | radiog_small-73x72.jpg | 2023-12-05 09:50 | 2.1K | |
![[IMG]](/icons/image2.gif) | www.png | 2023-12-05 09:50 | 2.1K | |
![[IMG]](/icons/image2.gif) | canva_pattern3.png | 2023-12-05 09:50 | 2.1K | |
![[IMG]](/icons/image2.gif) | vethos-73x72.jpg | 2023-12-05 09:50 | 2.1K | |
![[IMG]](/icons/image2.gif) | canva_preloader.gif | 2023-12-05 09:50 | 2.1K | |
![[IMG]](/icons/image2.gif) | canva_preloader-dark.gif | 2023-12-05 09:50 | 2.1K | |
![[TXT]](/icons/text.gif) | canva_typography.css | 2023-12-05 09:50 | 2.1K | |
![[TXT]](/icons/text.gif) | canva_layouts.css | 2023-12-05 09:50 | 2.1K | |
![[IMG]](/icons/image2.gif) | 1may-80x94.png | 2023-12-05 09:49 | 2.2K | |
![[ ]](/icons/unknown.gif) | canva_font-icons-snapchat.ttf | 2023-12-05 09:50 | 2.2K | |
![[IMG]](/icons/image2.gif) | 3-2-35x35.png | 2023-12-05 09:50 | 2.2K | |
![[ ]](/icons/unknown.gif) | canva_font-icons-snapchat.woff | 2023-12-05 09:50 | 2.3K | |
![[TXT]](/icons/text.gif) | canva_team.css | 2023-12-05 09:50 | 2.4K | |
![[ ]](/icons/unknown.gif) | canva_font-icons-snapchat.eot | 2023-12-05 09:50 | 2.4K | |
![[IMG]](/icons/image2.gif) | 3-2-33x40.png | 2023-12-05 09:50 | 2.4K | |
![[TXT]](/icons/text.gif) | canva_countdown.css | 2023-12-05 09:50 | 2.5K | |
![[TXT]](/icons/text.gif) | canva_chart-utils.js | 2023-12-05 09:50 | 2.5K | |
![[TXT]](/icons/text.gif) | canva_radio-checkbox.css | 2023-12-05 09:50 | 2.5K | |
![[TXT]](/icons/text.gif) | canva_footer.css | 2023-12-05 09:50 | 2.6K | |
![[IMG]](/icons/image2.gif) | registry-sidebar-thumb-1.jpg | 2023-12-05 09:50 | 2.6K | |
![[IMG]](/icons/image2.gif) | 24 Welcome-100x100.png | 2023-12-05 09:50 | 2.6K | |
![[IMG]](/icons/image2.gif) | email.png | 2023-12-05 09:50 | 2.7K | |
![[IMG]](/icons/image2.gif) | registry-sidebar-thumb-3.jpg | 2023-12-05 09:50 | 2.7K | |
![[TXT]](/icons/text.gif) | canva_jquery.mousewheel.min.js | 2023-12-05 09:50 | 2.7K | |
![[IMG]](/icons/image2.gif) | applytfer-122x48.PNG | 2023-12-05 09:50 | 2.7K | |
![[TXT]](/icons/text.gif) | canva_jquery.hotspot.js | 2023-12-05 09:50 | 2.8K | |
![[IMG]](/icons/image2.gif) | ucdcollegesandschools_search-icon-blue.png | 2023-12-05 09:50 | 3.0K | |
![[IMG]](/icons/image2.gif) | stafflisting-placeholder.png | 2024-06-13 07:15 | 3.0K | |
![[TXT]](/icons/text.gif) | canva_overlay.css | 2023-12-05 09:50 | 3.1K | |
![[IMG]](/icons/image2.gif) | 21 June calendar image-92x118.png | 2023-12-05 09:50 | 3.3K | |
![[TXT]](/icons/text.gif) | canva_counter-skills.css | 2023-12-05 09:50 | 3.4K | |
![[IMG]](/icons/image2.gif) | 21 June calendar image-96x120.png | 2023-12-05 09:50 | 3.4K | |
![[TXT]](/icons/text.gif) | canva_selectsplitter.js | 2023-12-05 09:50 | 3.4K | |
![[TXT]](/icons/text.gif) | canva_dividers.css | 2023-12-05 09:50 | 3.4K | |
![[TXT]](/icons/text.gif) | canva_jquery.twitterfeed.js | 2023-12-05 09:50 | 3.5K | |
![[TXT]](/icons/text.gif) | canva_flipcard.css | 2023-12-05 09:50 | 3.5K | |
![[TXT]](/icons/text.gif) | canva_events.css | 2023-12-05 09:50 | 3.5K | |
![[IMG]](/icons/image2.gif) | canva_banner-curve.png | 2023-12-05 09:50 | 3.5K | |
![[IMG]](/icons/image2.gif) | 400w300h-keydates-103x78.jpg | 2023-12-05 09:50 | 3.5K | |
![[TXT]](/icons/text.gif) | canva_fonts.css | 2023-12-05 09:50 | 3.6K | |
![[TXT]](/icons/text.gif) | canva_toggles-accordions.css | 2023-12-05 09:50 | 3.8K | |
![[TXT]](/icons/text.gif) | canva_jquery.gmap.js | 2023-12-05 09:50 | 3.8K | |
![[TXT]](/icons/text.gif) | canva_jquery.piechart.js | 2023-12-05 09:50 | 3.9K | |
![[IMG]](/icons/image2.gif) | canva_font-icons-snapchat.svg | 2023-12-05 09:50 | 4.0K | |
![[TXT]](/icons/text.gif) | canva_topbar.css | 2023-12-05 09:50 | 4.2K | |
![[TXT]](/icons/text.gif) | canva_jquery.dribbble.js | 2023-12-05 09:50 | 4.3K | |
![[TXT]](/icons/text.gif) | canva_testimonials.css | 2023-12-05 09:50 | 4.3K | |
![[TXT]](/icons/text.gif) | canva_pagetitle.css | 2023-12-05 09:50 | 4.3K | |
![[IMG]](/icons/image2.gif) | canva_preloader@2x.gif | 2023-12-05 09:50 | 4.6K | |
![[IMG]](/icons/image2.gif) | canva_preloader-dark@2x.gif | 2023-12-05 09:50 | 4.7K | |
![[TXT]](/icons/text.gif) | canva_promo.css | 2023-12-05 09:50 | 4.7K | |
![[TXT]](/icons/text.gif) | canva_ion.rangeslider.css | 2023-12-05 09:50 | 5.1K | |
![[TXT]](/icons/text.gif) | canva_styled-icons.css | 2023-12-05 09:50 | 5.1K | |
![[TXT]](/icons/text.gif) | canva_jquery.toastr.js | 2023-12-05 09:50 | 5.1K | |
![[TXT]](/icons/text.gif) | canva_headings.css | 2023-12-05 09:50 | 5.2K | |
![[TXT]](/icons/text.gif) | canva_pricing.css | 2023-12-05 09:50 | 5.4K | |
![[TXT]](/icons/text.gif) | bs-datatable.css | 2023-12-05 09:50 | 5.4K | |
![[TXT]](/icons/text.gif) | canva_bs-datatable.css | 2023-12-05 09:50 | 5.4K | |
![[TXT]](/icons/text.gif) | canva_dark-rtl.css | 2023-12-05 09:50 | 5.5K | |
![[TXT]](/icons/text.gif) | canva_jquery.pagetransition.js | 2023-12-05 09:50 | 5.6K | |
![[IMG]](/icons/image2.gif) | guidance2.png | 2023-12-05 09:50 | 6.1K | |
![[TXT]](/icons/text.gif) | canva_carousel.css | 2023-12-05 09:50 | 6.5K | |
![[TXT]](/icons/text.gif) | canva_jquery.color.js | 2023-12-05 09:50 | 6.6K | |
![[TXT]](/icons/text.gif) | canva_jquery.superfish.js | 2023-12-05 09:50 | 6.6K | |
![[TXT]](/icons/text.gif) | canva_bs-rating.css | 2023-12-05 09:50 | 6.6K | |
![[TXT]](/icons/text.gif) | canva_jquery.instagram.js | 2023-12-05 09:50 | 6.6K | |
![[TXT]](/icons/text.gif) | canva_helpers.css | 2023-12-05 09:50 | 6.6K | |
![[TXT]](/icons/text.gif) | canva_jquery.paginate.js | 2023-12-05 09:50 | 6.9K | |
![[IMG]](/icons/image2.gif) | 120px-lake-night.jpg | 2024-03-08 12:52 | 6.9K | |
![[TXT]](/icons/text.gif) | canva_responsive-rtl.css | 2023-12-05 09:50 | 7.1K | |
![[TXT]](/icons/text.gif) | canva_magnific-popup.css | 2023-12-05 09:50 | 7.2K | |
![[IMG]](/icons/image2.gif) | In Module Resit Grade Scale.png | 2024-12-13 14:43 | 7.3K | |
![[IMG]](/icons/image2.gif) | ucdmaincore_logo-footer.png | 2023-12-05 09:50 | 7.3K | |
![[TXT]](/icons/text.gif) | registry-canva.css | 2023-12-05 09:50 | 7.3K | |
![[IMG]](/icons/image2.gif) | canva_world-map.png | 2023-12-05 09:50 | 7.5K | |
![[TXT]](/icons/text.gif) | canva_tabs.css | 2023-12-05 09:50 | 7.5K | |
![[IMG]](/icons/image2.gif) | 120px-telephone-dialer.jpg | 2024-03-08 12:52 | 7.7K | |
![[TXT]](/icons/text.gif) | canva_daterangepicker.css | 2023-12-05 09:50 | 7.9K | |
![[IMG]](/icons/image2.gif) | Grade Scale for Passed In Module Component repeat.png | 2024-12-13 14:43 | 7.9K | |
![[IMG]](/icons/image2.gif) | 120px-girl-smile.jpg | 2023-12-05 09:49 | 8.3K | |
![[TXT]](/icons/text.gif) | canva_timepicker.css | 2023-12-05 09:50 | 8.3K | |
![[TXT]](/icons/text.gif) | canva_bs-filestyle.css | 2023-12-05 09:50 | 8.3K | |
![[TXT]](/icons/text.gif) | canva_shop.css | 2023-12-05 09:50 | 8.4K | |
![[TXT]](/icons/text.gif) | canva_colors.css | 2023-12-05 09:50 | 8.5K | |
![[TXT]](/icons/text.gif) | canva_widgets.css | 2023-12-05 09:50 | 9.0K | |
![[IMG]](/icons/image2.gif) | Supervisor Approves thesis for exam pic 3.jpg | 2025-03-24 12:43 | 9.0K | |
![[IMG]](/icons/image2.gif) | apply.png | 2023-12-05 09:50 | 9.2K | |
![[IMG]](/icons/image2.gif) | 120px-phone.jpg | 2023-12-05 09:49 | 9.4K | |
![[IMG]](/icons/image2.gif) | question.jpg | 2023-12-05 09:50 | 9.5K | |
![[TXT]](/icons/text.gif) | canva_jquery.calendario.js | 2023-12-05 09:50 | 9.6K | |
![[TXT]](/icons/text.gif) | canva_jquery-migrate.min.js | 2023-12-05 09:50 | 9.8K | |
![[IMG]](/icons/image2.gif) | imgpsh_mobile_save-1-614x97.jpg | 2023-12-05 09:50 | 9.9K | |
![[TXT]](/icons/text.gif) | canva_bs-select.css | 2023-12-05 09:50 | 10K | |
![[IMG]](/icons/image2.gif) | imgpsh_mobile_save-616x90.jpg | 2023-12-05 09:50 | 10K | |
![[TXT]](/icons/text.gif) | canva_calendar.css | 2023-12-05 09:50 | 11K | |
![[IMG]](/icons/image2.gif) | How to calculate the QPV image.png | 2024-12-13 14:43 | 11K | |
![[TXT]](/icons/text.gif) | canva_bootstrap-rtl.css | 2023-12-05 09:50 | 12K | |
![[TXT]](/icons/text.gif) | canva_sliders.css | 2023-12-05 09:50 | 12K | |
![[TXT]](/icons/text.gif) | canva_jquery.parallax.js | 2023-12-05 09:50 | 12K | |
![[IMG]](/icons/image2.gif) | canva_footer-bg.jpg | 2023-12-05 09:50 | 12K | |
![[TXT]](/icons/text.gif) | canva_dark-components.css | 2023-12-05 09:50 | 12K | |
![[TXT]](/icons/text.gif) | canva_star-rating.js | 2023-12-05 09:50 | 13K | |
![[ ]](/icons/unknown.gif) | la-regular-400-1.woff2 | 2024-03-08 12:52 | 13K | |
![[ ]](/icons/unknown.gif) | la-regular-400.woff2 | 2025-02-20 15:43 | 13K | |
![[IMG]](/icons/image2.gif) | REG007_Lake.jpg | 2024-03-08 12:52 | 13K | |
![[TXT]](/icons/text.gif) | canva_social-icons.css | 2023-12-05 09:50 | 13K | |
![[IMG]](/icons/image2.gif) | Repeat Module Grade Scale.png | 2024-12-13 14:43 | 13K | |
![[IMG]](/icons/image2.gif) | RPL Online Applications.png | 2023-12-05 09:50 | 13K | |
![[IMG]](/icons/image2.gif) | Other Modules grades (synospis).png | 2024-12-13 14:43 | 13K | |
![[IMG]](/icons/image2.gif) | Combined PDF on Structure Report-646x99.PNG | 2025-02-13 15:09 | 13K | |
![[IMG]](/icons/image2.gif) | 24 Welcome-100x100-200x200.png | 2023-12-05 09:50 | 13K | |
![[IMG]](/icons/image2.gif) | regist-logo-290w100h.png | 2023-12-05 09:50 | 14K | |
![[IMG]](/icons/image2.gif) | canva_camera_skins.png | 2023-12-05 09:50 | 14K | |
![[TXT]](/icons/text.gif) | canva_misc.css | 2023-12-05 09:50 | 14K | |
![[IMG]](/icons/image2.gif) | super_permit2-800x86.png | 2025-03-24 12:43 | 14K | |
![[TXT]](/icons/text.gif) | canva_bs-switches.css | 2023-12-05 09:50 | 14K | |
![[TXT]](/icons/text.gif) | canva_bs-switches.js | 2023-12-05 09:50 | 15K | |
![[TXT]](/icons/text.gif) | canva_buttons.css | 2023-12-05 09:50 | 15K | |
![[TXT]](/icons/text.gif) | canva_jquery.form.js | 2023-12-05 09:50 | 15K | |
![[ ]](/icons/unknown.gif) | la-regular-400-1.woff | 2024-03-08 12:52 | 15K | |
![[ ]](/icons/unknown.gif) | la-regular-400.woff | 2025-02-20 15:43 | 15K | |
![[TXT]](/icons/text.gif) | canva_datepicker.css | 2023-12-05 09:50 | 15K | |
![[TXT]](/icons/text.gif) | canva_feature-box.css | 2023-12-05 09:50 | 16K | |
![[IMG]](/icons/image2.gif) | Guide to Registry pic-386x280.JPG | 2023-12-05 09:50 | 16K | |
![[TXT]](/icons/text.gif) | canva_events-data.js | 2023-12-05 09:50 | 16K | |
![[TXT]](/icons/text.gif) | canva_blog.css | 2023-12-05 09:50 | 16K | |
![[TXT]](/icons/text.gif) | canva_jquery.countdown.js | 2023-12-05 09:50 | 16K | |
![[IMG]](/icons/image2.gif) | Pass Fail Module Grades.png | 2024-12-13 14:43 | 17K | |
![[TXT]](/icons/text.gif) | canva_select-boxes.css | 2023-12-05 09:50 | 17K | |
![[IMG]](/icons/image2.gif) | idea.jpg | 2025-02-06 16:40 | 17K | |
![[IMG]](/icons/image2.gif) | karen.jpeg | 2024-03-08 12:52 | 18K | |
![[IMG]](/icons/image2.gif) | GPA neutral calculations example.png | 2024-12-13 14:43 | 18K | |
![[IMG]](/icons/image2.gif) | crest-ucd.svg | 2024-03-08 12:52 | 18K | |
![[IMG]](/icons/image2.gif) | registrar_header_navy.jpeg | 2023-12-05 09:50 | 18K | |
![[IMG]](/icons/image2.gif) | Module Resit Assessment Grade Scale.png | 2024-12-13 14:43 | 19K | |
![[TXT]](/icons/text.gif) | canva_swiper.css | 2023-12-05 09:50 | 19K | |
![[IMG]](/icons/image2.gif) | logo-footer.svg | 2024-03-08 12:52 | 19K | |
![[IMG]](/icons/image2.gif) | Mandatory Data Complete-456x158.png | 2023-12-05 09:50 | 19K | |
![[TXT]](/icons/text.gif) | canva_jquery.magnific.js | 2023-12-05 09:50 | 20K | |
![[IMG]](/icons/image2.gif) | grid-repeat-1.png | 2024-03-08 12:52 | 20K | |
![[IMG]](/icons/image2.gif) | grid-repeat.png | 2025-02-20 15:43 | 20K | |
![[IMG]](/icons/image2.gif) | Image of Hardbound Thesis-537x385.jpg | 2025-03-24 15:44 | 20K | |
![[IMG]](/icons/image2.gif) | Prosp23.PNG | 2023-12-05 09:50 | 21K | |
![[ ]](/icons/layout.gif) | Example_of_UCD_Module_Descriptor.pdf | 2024-03-08 12:52 | 21K | |
![[ ]](/icons/layout.gif) | GAP 2021 Key Dates.pdf | 2023-12-05 09:50 | 21K | |
![[IMG]](/icons/image2.gif) | paola.jpg | 2024-03-08 12:52 | 22K | |
![[ ]](/icons/layout.gif) | Proposal Form AEGROTAT AND POSTHUMOUS AWARD.pdf | 2024-03-08 12:52 | 22K | |
![[IMG]](/icons/image2.gif) | apple-touch-icon-1.png | 2024-03-08 12:52 | 22K | |
![[IMG]](/icons/image2.gif) | apple-touch-icon.png | 2025-02-20 15:43 | 22K | |
![[IMG]](/icons/image2.gif) | Standard Module Overall Grades.png | 2024-12-13 14:43 | 22K | |
![[TXT]](/icons/text.gif) | canva_animate.css | 2023-12-05 09:50 | 22K | |
![[TXT]](/icons/text.gif) | canva_jquery.important.js | 2023-12-05 09:50 | 22K | |
![[TXT]](/icons/text.gif) | canva_pricing-table.css | 2023-12-05 09:50 | 22K | |
![[TXT]](/icons/text.gif) | canva_jquery.flexslider.js | 2023-12-05 09:50 | 22K | |
![[ ]](/icons/layout.gif) | Post Timetable Verification Changes Request Workflow.pdf | 2023-12-04 14:20 | 23K | |
![[TXT]](/icons/text.gif) | canva_jquery.validation.js | 2023-12-05 09:50 | 23K | |
![[IMG]](/icons/image2.gif) | Mandatory Data missing-593x125.png | 2023-12-05 09:50 | 23K | |
![[TXT]](/icons/text.gif) | canva_extras.css | 2023-12-05 09:50 | 24K | |
![[TXT]](/icons/text.gif) | canva_responsive-tabs.js | 2023-12-05 09:50 | 25K | |
![[TXT]](/icons/text.gif) | canva_jquery.infinitescroll.js | 2023-12-05 09:50 | 25K | |
![[IMG]](/icons/image2.gif) | Component gpn grades.PNG | 2024-12-13 14:43 | 26K | |
![[IMG]](/icons/image2.gif) | calendar.jpg | 2025-02-06 10:39 | 26K | |
![[IMG]](/icons/image2.gif) | learning2.jpg | 2025-02-06 16:40 | 27K | |
![[ ]](/icons/layout.gif) | Useful_Banner_Forms_2022.pdf | 2023-12-04 16:18 | 27K | |
![[IMG]](/icons/image2.gif) | working.jpg | 2025-02-06 10:39 | 27K | |
![[IMG]](/icons/image2.gif) | student_types.jpg | 2023-12-05 09:50 | 27K | |
![[ ]](/icons/layout.gif) | UCD_Academic_Level_Descriptors.pdf | 2024-03-08 12:52 | 27K | |
![[IMG]](/icons/image2.gif) | Component to Module Grades Calculation Examples.png | 2024-12-13 14:43 | 28K | |
![[IMG]](/icons/image2.gif) | supersubmit1-800x101.png | 2025-03-24 12:43 | 28K | |
![[IMG]](/icons/image2.gif) | clock.jpg | 2025-02-06 10:39 | 28K | |
![[ ]](/icons/unknown.gif) | Lato-Black.woff2 | 2024-03-08 12:52 | 28K | |
![[IMG]](/icons/image2.gif) | laptop_closing.jpg | 2025-02-06 10:39 | 28K | |
![[ ]](/icons/unknown.gif) | Lato-Bold.woff2 | 2024-03-08 12:52 | 28K | |
![[ ]](/icons/unknown.gif) | GradVet_Supplementary_Form (2022).docx | 2023-12-05 09:50 | 28K | |
![[ ]](/icons/unknown.gif) | Lato-Regular.woff2 | 2024-03-08 12:52 | 29K | |
![[IMG]](/icons/image2.gif) | calendar3.jpg | 2025-02-06 10:39 | 29K | |
![[ ]](/icons/unknown.gif) | Lato-Italic.woff2 | 2024-03-08 12:52 | 30K | |
![[IMG]](/icons/image2.gif) | Assessment types.png | 2024-12-13 14:43 | 30K | |
![[IMG]](/icons/image2.gif) | image (10)-846x166.png | 2025-03-24 12:43 | 30K | |
![[IMG]](/icons/image2.gif) | learning4.jpg | 2025-02-06 16:40 | 30K | |
![[IMG]](/icons/image2.gif) | writing.jpg | 2025-02-06 10:39 | 30K | |
![[ ]](/icons/layout.gif) | Updated Concession_form_CoS_Spouse.pdf | 2023-12-05 09:50 | 30K | |
![[IMG]](/icons/image2.gif) | regist-logo-580w200h.png | 2023-12-05 09:50 | 31K | |
![[IMG]](/icons/image2.gif) | mcq.jpg | 2025-02-06 10:39 | 31K | |
![[IMG]](/icons/image2.gif) | calendar2.jpg | 2025-02-06 10:39 | 31K | |
![[IMG]](/icons/image2.gif) | are_you_ready.jpg | 2025-02-06 10:39 | 31K | |
![[TXT]](/icons/text.gif) | canva_holder.js | 2023-12-05 09:50 | 31K | |
![[ ]](/icons/unknown.gif) | Sample Exam Paper Cover (1).docx | 2024-03-08 12:52 | 31K | |
![[IMG]](/icons/image2.gif) | comms.jpg | 2025-02-06 10:39 | 31K | |
![[TXT]](/icons/text.gif) | canva_portfolio.css | 2023-12-05 09:50 | 32K | |
![[IMG]](/icons/image2.gif) | Example of Calculating Semester GPA-554x332.png | 2024-12-13 14:43 | 32K | |
![[ ]](/icons/unknown.gif) | Sample Exam Paper Cover With Irish.docx | 2024-11-06 11:28 | 32K | |
![[ ]](/icons/layout.gif) | UCD_Levels_and_NFQ_Levels_Explanation.pdf | 2023-12-05 09:50 | 32K | |
![[ ]](/icons/layout.gif) | Banner_freq shortcuts and icons_July_2021.pdf | 2023-12-04 16:18 | 32K | |
![[IMG]](/icons/image2.gif) | 300w-study-hall-aerial.jpg | 2023-12-05 09:50 | 32K | |
![[IMG]](/icons/image2.gif) | Component to Module grade calculation points.png | 2024-12-13 14:43 | 32K | |
![[IMG]](/icons/image2.gif) | registrar_header_navy.png | 2023-12-05 09:50 | 32K | |
![[TXT]](/icons/text.gif) | canva_datepicker.js | 2023-12-05 09:50 | 33K | |
![[ ]](/icons/unknown.gif) | la-regular-400-1.ttf | 2024-03-08 12:52 | 33K | |
![[ ]](/icons/unknown.gif) | la-regular-400.ttf | 2025-02-20 15:43 | 33K | |
![[IMG]](/icons/image2.gif) | graphs.jpg | 2025-02-06 10:39 | 33K | |
![[ ]](/icons/unknown.gif) | la-regular-400-1.eot | 2024-03-08 12:52 | 33K | |
![[ ]](/icons/unknown.gif) | la-regular-400.eot | 2025-02-20 15:43 | 33K | |
![[ ]](/icons/unknown.gif) | canva_lined-icons.ttf | 2023-12-05 09:50 | 33K | |
![[ ]](/icons/layout.gif) | ACCE_Terms_of_Reference.pdf | 2023-12-05 09:50 | 34K | |
![[ ]](/icons/unknown.gif) | canva_lined-icons.eot | 2023-12-05 09:50 | 34K | |
![[ ]](/icons/layout.gif) | University Level timetable process.pdf | 2023-12-04 14:20 | 34K | |
![[IMG]](/icons/image2.gif) | pencils.jpg | 2025-02-06 16:40 | 34K | |
![[ ]](/icons/unknown.gif) | Sample_Exam_Coversheet.docx | 2024-03-12 15:50 | 34K | |
![[ ]](/icons/unknown.gif) | Sample exam question paper cover sheet.docx | 2024-03-08 12:52 | 34K | |
![[IMG]](/icons/image2.gif) | Review 2022 thumbnail.JPG | 2023-12-05 09:50 | 34K | |
![[ ]](/icons/unknown.gif) | canva_Simple-Line-Icons.ttf | 2023-12-05 09:50 | 34K | |
![[TXT]](/icons/text.gif) | canva_bs-select.js | 2023-12-05 09:50 | 34K | |
![[IMG]](/icons/image2.gif) | Apprpval of Joint Degree Report .jpg | 2025-03-24 15:44 | 35K | |
![[ ]](/icons/unknown.gif) | canva_Simple-Line-Icons.eot | 2023-12-05 09:50 | 35K | |
![[ ]](/icons/unknown.gif) | Lato-Black.woff | 2024-03-08 12:52 | 35K | |
![[ ]](/icons/unknown.gif) | Lato-Bold.woff | 2024-03-08 12:52 | 36K | |
![[IMG]](/icons/image2.gif) | Supervisor Approves thesis for exam revised.jpg | 2025-03-24 12:43 | 36K | |
![[ ]](/icons/layout.gif) | UCD APPLICATIONS UPDATE Sep 2021.pdf | 2023-12-05 09:50 | 37K | |
![[ ]](/icons/unknown.gif) | Lato-Regular.woff | 2024-03-08 12:52 | 37K | |
![[ ]](/icons/unknown.gif) | canva_lined-icons.woff | 2023-12-05 09:50 | 37K | |
![[IMG]](/icons/image2.gif) | 18.02-520x152.PNG | 2025-02-18 16:09 | 37K | |
![[TXT]](/icons/text.gif) | canva_jquery.tabs.js | 2023-12-05 09:50 | 37K | |
![[IMG]](/icons/image2.gif) | data missing details-458x253.PNG | 2023-12-05 09:50 | 37K | |
![[ ]](/icons/layout.gif) | Deadline for grade changes ahead of conferring.pdf | 2023-12-05 09:50 | 38K | |
![[ ]](/icons/unknown.gif) | Lato-Italic.woff | 2024-03-08 12:52 | 38K | |
![[IMG]](/icons/image2.gif) | Three Stage Degree Rule Example.PNG | 2024-12-13 14:43 | 38K | |
![[IMG]](/icons/image2.gif) | Thesis submission 1 (4) 29 Jan.JPG | 2025-03-24 15:13 | 39K | |
![[IMG]](/icons/image2.gif) | Registry staff structure June 2023-959x403.JPG | 2023-12-05 09:50 | 40K | |
![[TXT]](/icons/text.gif) | canva_rangeslider.min.js | 2023-12-05 09:50 | 40K | |
![[TXT]](/icons/text.gif) | canva_jquery.isotope.js | 2023-12-05 09:50 | 40K | |
![[IMG]](/icons/image2.gif) | Example of Final and penultimate stages stage-weighted FinalPen Weighted 7030 (image) Ver2.PNG | 2024-12-13 14:43 | 40K | |
![[IMG]](/icons/image2.gif) | GAP workflows image.PNG | 2024-12-13 14:43 | 40K | |
![[IMG]](/icons/image2.gif) | learning3.jpg | 2025-02-06 16:40 | 41K | |
![[ ]](/icons/unknown.gif) | ACCE Change of Examination Committee Intern Form 090524.docx | 2024-05-09 15:18 | 41K | |
![[IMG]](/icons/image2.gif) | screen.jpg | 2025-02-06 10:39 | 41K | |
![[TXT]](/icons/text.gif) | canva_responsive.css | 2023-12-05 09:50 | 41K | |
![[IMG]](/icons/image2.gif) | slider-200w1329h-enrollmentForm-1.jpg | 2023-12-05 09:50 | 41K | |
![[IMG]](/icons/image2.gif) | slider-200w1329h-enrollmentForm.jpg | 2024-03-08 12:52 | 41K | |
![[ ]](/icons/layout.gif) | ACCE SubCommittee TOR-1.pdf | 2024-03-08 12:52 | 41K | |
![[ ]](/icons/layout.gif) | Summer Trimester, Graduate Taught Grade Approvals Process Revised Dates.pdf | 2023-12-05 09:50 | 42K | |
![[IMG]](/icons/image2.gif) | Component grades image2.PNG | 2024-12-13 14:43 | 42K | |
![[ ]](/icons/layout.gif) | Where_to_find_UCD_student_information.pdf | 2025-02-22 00:09 | 42K | |
![[TXT]](/icons/text.gif) | canva_header.css | 2023-12-05 09:50 | 43K | |
![[TXT]](/icons/text.gif) | canva_jquery.owlcarousel.js | 2023-12-05 09:50 | 43K | |
![[ ]](/icons/layout.gif) | Virtual Viva Voce Examination Checklist.pdf | 2024-03-08 12:52 | 43K | |
![[ ]](/icons/unknown.gif) | PDARF14.docx | 2024-03-08 12:52 | 44K | |
![[ ]](/icons/layout.gif) | Access to UCD Systems for Extern Examiners.pdf | 2024-03-08 12:52 | 44K | |
![[IMG]](/icons/image2.gif) | learning.jpg | 2025-02-06 16:40 | 44K | |
![[ ]](/icons/unknown.gif) | ACCE Change of Examination Committee Chair Form 090524.docx | 2024-05-09 15:18 | 45K | |
![[ ]](/icons/layout.gif) | Retro_ withdrawal_form_Sept2020.pdf | 2023-12-05 09:50 | 45K | |
![[IMG]](/icons/image2.gif) | Grade Points (image).png | 2024-12-13 14:43 | 46K | |
![[TXT]](/icons/text.gif) | app.min.js | 2025-01-24 17:43 | 46K | |
![[IMG]](/icons/image2.gif) | Preliminary Reports-983x155.png | 2025-03-24 15:44 | 46K | |
![[IMG]](/icons/image2.gif) | Student_Types_2025-681x568.jpg | 2025-01-22 14:42 | 46K | |
![[IMG]](/icons/image2.gif) | How do I upload my thesis final doc 5_2_25.png | 2025-03-24 15:13 | 47K | |
![[ ]](/icons/layout.gif) | Week Ranges 2023-2024.pdf | 2024-03-08 12:52 | 48K | |
![[ ]](/icons/layout.gif) | Where to find UCD Student Information.pdf | 2023-12-04 16:18 | 48K | |
![[TXT]](/icons/text.gif) | canva_font-icons.css | 2023-12-05 09:50 | 48K | |
![[ ]](/icons/unknown.gif) | Grad Entry Vet Med Guidelines.docx | 2023-12-05 09:50 | 48K | |
![[ ]](/icons/layout.gif) | Student fitting finished for continuing students_Sept 2020_staff archive.pdf | 2023-12-05 09:50 | 48K | |
![[ ]](/icons/layout.gif) | Module registration unavailable in SFAREGS during Elective Allocation_archive.pdf | 2023-12-05 09:50 | 49K | |
![[ ]](/icons/layout.gif) | Student Fitting Sept 2020_staff_archive.pdf | 2023-12-05 09:50 | 49K | |
![[ ]](/icons/layout.gif) | 24-07-24 Module Places Closing Careers and Skills Statements.pdf | 2024-07-25 07:45 | 49K | |
![[ ]](/icons/layout.gif) | Edits to May-intake Majors Open.pdf | 2024-04-23 09:16 | 49K | |
![[TXT]](/icons/text.gif) | canva_daterangepicker.js | 2023-12-05 09:50 | 50K | |
![[IMG]](/icons/image2.gif) | image (12).png | 2025-03-24 15:44 | 50K | |
![[IMG]](/icons/image2.gif) | Module remediation.jpg | 2025-02-19 13:09 | 50K | |
![[ ]](/icons/layout.gif) | Elective Allocation - staff email.pdf | 2023-12-05 09:50 | 50K | |
![[ ]](/icons/layout.gif) | Staff April 2022 eThesis Zoom clinic invite.pdf | 2023-12-05 09:50 | 51K | |
![[ ]](/icons/unknown.gif) | Details of Practical Experience.docx | 2024-03-08 12:52 | 51K | |
![[ ]](/icons/layout.gif) | 2024-04-17 Edits to May-intake Majors Closing.pdf | 2024-04-18 07:46 | 51K | |
![[TXT]](/icons/text.gif) | canva_dark.css | 2023-12-05 09:50 | 52K | |
![[IMG]](/icons/image2.gif) | Preliminary Reports-1.png | 2025-03-24 15:44 | 53K | |
![[ ]](/icons/unknown.gif) | Details_Vet_Exp.dotx | 2023-12-05 09:50 | 53K | |
![[ ]](/icons/layout.gif) | Alternative Linear Conversion Grade Scale 40% Pass.pdf | 2025-04-07 11:13 | 53K | |
![[ ]](/icons/layout.gif) | Alternative Linear Conversion Grade Scale 40 per cent Pass.pdf | 2025-04-08 10:44 | 53K | |
![[ ]](/icons/layout.gif) | Alternative Non-Linear Conversion Grade Scale 50% Pass.pdf | 2025-04-07 11:13 | 54K | |
![[IMG]](/icons/image2.gif) | parchment_sample.jpg | 2024-03-08 12:52 | 54K | |
![[ ]](/icons/layout.gif) | Other Module Grades.pdf | 2024-12-13 14:43 | 54K | |
![[IMG]](/icons/image2.gif) | Submission of JDR.png | 2025-03-24 15:44 | 54K | |
![[ ]](/icons/layout.gif) | Summer Module Edits Open &Assessment Strategy Changes.pdf | 2024-04-23 16:16 | 54K | |
![[ ]](/icons/layout.gif) | Intern-Examiner-Payment-Process-Map.pdf | 2024-03-08 12:52 | 54K | |
![[ ]](/icons/layout.gif) | Alternative Linear Conversion Grade Scale 60 % (China only).pdf | 2025-04-07 15:43 | 55K | |
![[TXT]](/icons/text.gif) | canva_timepicker.js | 2023-12-05 09:50 | 55K | |
![[ ]](/icons/layout.gif) | 02-07-24 Final Module Trimester Status Changes.pdf | 2024-07-03 15:45 | 55K | |
![[ ]](/icons/layout.gif) | Exceptional Grade Change Request Workflow.pdf | 2023-12-05 09:50 | 55K | |
![[IMG]](/icons/image2.gif) | Submission of Preliminary Report Pic .jpg | 2025-03-24 15:44 | 55K | |
![[ ]](/icons/layout.gif) | 14.09.22 Academic Council Committee on Examinations ACCE Update.pdf | 2024-03-08 12:52 | 56K | |
![[ ]](/icons/unknown.gif) | PDARF8 Pathway Programme Proposal_Final Sept 2020.docx | 2024-03-08 12:52 | 56K | |
![[ ]](/icons/layout.gif) | Standard Conversion Grade Scale 40% Pass.pdf | 2025-04-07 11:13 | 56K | |
![[ ]](/icons/layout.gif) | Standard_Conversion_Grade_Scale_40_Pass.pdf | 2025-04-07 16:12 | 56K | |
![[IMG]](/icons/image2.gif) | Approval of Final Thesis revisions .jpg | 2025-03-24 15:44 | 57K | |
![[ ]](/icons/layout.gif) | Budget_2023_staff.pdf | 2024-03-08 12:52 | 57K | |
![[ ]](/icons/layout.gif) | Banner_9_will_be_available_on_25 March_2020.pdf | 2023-12-05 09:50 | 57K | |
![[ ]](/icons/unknown.gif) | PDARF1 UCD Partnership Proposal Form (UMT)_Final.docx | 2024-03-08 12:52 | 57K | |
![[ ]](/icons/layout.gif) | Fee_Summary_info_in_Banner.pdf | 2023-12-05 09:50 | 57K | |
![[IMG]](/icons/image2.gif) | slider-200w1329h-lake-1.jpg | 2024-03-08 12:52 | 57K | |
![[IMG]](/icons/image2.gif) | slider-200w1329h-lake-2.jpg | 2023-12-05 09:50 | 57K | |
![[IMG]](/icons/image2.gif) | slider-200w1329h-lake.jpg | 2024-03-08 12:52 | 57K | |
![[IMG]](/icons/image2.gif) | Chair Oversight of thesis revisions.png | 2025-03-24 15:44 | 58K | |
![[IMG]](/icons/image2.gif) | Supervisor What Happens Next.png | 2025-03-24 12:43 | 58K | |
![[ ]](/icons/unknown.gif) | canva_Simple-Line-Icons.woff | 2023-12-05 09:50 | 58K | |
![[ ]](/icons/layout.gif) | 13-03-25 CMS open for May-Intake Major Edits.pdf | 2025-03-13 17:12 | 58K | |
![[ ]](/icons/layout.gif) | Times_confirmed_Banner_Update.pdf | 2023-12-05 09:50 | 58K | |
![[TXT]](/icons/text.gif) | canva_jquery.chart.js | 2023-12-05 09:50 | 58K | |
![[ ]](/icons/unknown.gif) | PDARF4 Collaborative Programme Supplement_Final Sept 2020.docx | 2024-03-08 12:52 | 58K | |
![[ ]](/icons/layout.gif) | Banner_Version_update_weekend_12-13_March_22.pdf | 2023-12-05 09:50 | 58K | |
![[IMG]](/icons/image2.gif) | lizanne (1).jpeg | 2024-03-08 12:52 | 58K | |
![[IMG]](/icons/image2.gif) | emma.jpeg | 2024-03-08 12:52 | 59K | |
![[IMG]](/icons/image2.gif) | Elena Keany.jpg | 2024-06-27 10:15 | 59K | |
![[ ]](/icons/layout.gif) | SpringTrimesterChangesTimetablingTimelines.pdf | 2024-03-08 12:52 | 60K | |
![[IMG]](/icons/image2.gif) | elena.jpeg | 2024-03-08 12:52 | 60K | |
![[TXT]](/icons/text.gif) | canva_jquery.youtube.js | 2023-12-05 09:50 | 61K | |
![[IMG]](/icons/image2.gif) | Chair Oversight of thesis revisions-606x171.png | 2025-03-24 15:44 | 61K | |
![[ ]](/icons/layout.gif) | IT_Systems_access_Feb_2023.pdf | 2023-12-05 09:50 | 61K | |
![[ ]](/icons/unknown.gif) | PDARF 16 Structure Change Proposal.docx | 2024-03-08 12:52 | 61K | |
![[ ]](/icons/unknown.gif) | PDARF6 Structured Elective 202425.docx | 2024-03-08 12:52 | 61K | |
![[ ]](/icons/unknown.gif) | PDARF3 New Programme Academic Structure Proposal_Final Oct 2020.docx | 2024-03-08 12:52 | 62K | |
![[ ]](/icons/layout.gif) | Alternative Non-Linear Conversion Grade Scale 40%.pdf | 2024-12-17 12:13 | 63K | |
![[ ]](/icons/layout.gif) | Alternative Non-Linear Conversion Grade Scale 40 perecent.pdf | 2024-12-17 12:43 | 63K | |
![[ ]](/icons/layout.gif) | Alternative Non-Linear Conversion Grade Scale 50%.pdf | 2024-12-17 11:13 | 63K | |
![[ ]](/icons/layout.gif) | Alternative Non-Linear Conversion Grade Scale 50 percent.pdf | 2024-12-17 12:43 | 63K | |
![[ ]](/icons/layout.gif) | Alternative Linear Conversion Grade Scale 60 A-) (to be used for modules held in China only).pdf | 2024-12-17 12:13 | 63K | |
![[ ]](/icons/unknown.gif) | PDARF7 Programme Change Proposal_Final Oct 2020.docx | 2024-03-08 12:52 | 63K | |
![[ ]](/icons/layout.gif) | 17.08.22 eThesis Submission one to one Zoom Clinics Sept.pdf | 2023-12-05 09:49 | 64K | |
![[ ]](/icons/layout.gif) | Required_Information_ for_ Special_ Extern_ Examiner _Nomination_form110324.docx.pdf | 2024-03-11 14:51 | 64K | |
![[ ]](/icons/layout.gif) | Banner 8 no longer available from 4 December 2020.pdf | 2023-12-05 09:50 | 64K | |
![[ ]](/icons/layout.gif) | Guidelines for conducting a Viva Voce remotely .pdf | 2024-03-08 12:52 | 65K | |
![[ ]](/icons/layout.gif) | Standard Conversion Grade Scale 40% Pass .pdf | 2024-12-17 12:13 | 66K | |
![[ ]](/icons/layout.gif) | Standard Conversion Grade Scale 40percent Pass.pdf | 2024-12-17 12:43 | 66K | |
![[ ]](/icons/unknown.gif) | PDARF7 Programme Change Proposal_Final Oct 2020 SEPT 2021 DRAFT.docx | 2024-09-27 12:45 | 66K | |
![[TXT]](/icons/text.gif) | canva_select-boxes.js | 2023-12-05 09:50 | 66K | |
![[IMG]](/icons/image2.gif) | fade-grid-right.svg | 2024-03-08 12:52 | 67K | |
![[ ]](/icons/unknown.gif) | PDARF6 Structured Elective and Specialisation Proposal_Change_Final.docx | 2023-12-04 14:20 | 67K | |
![[ ]](/icons/unknown.gif) | PDARF4 Collaborative Programme Supplement_Final Sept 2020 DRAFT SEPT 2021.docx | 2024-09-27 12:45 | 68K | |
![[IMG]](/icons/image2.gif) | Stage GPA Calculation Example (image)-623x548.png | 2024-12-13 14:43 | 68K | |
![[IMG]](/icons/image2.gif) | NightLake-1144x345.jpg | 2023-12-05 09:50 | 68K | |
![[IMG]](/icons/image2.gif) | fade-grid-left.svg | 2024-03-08 12:52 | 68K | |
![[IMG]](/icons/image2.gif) | canva_pattern.png | 2023-12-05 09:50 | 68K | |
![[ ]](/icons/layout.gif) | Change in application numbering system.pdf | 2024-03-08 12:52 | 69K | |
![[ ]](/icons/layout.gif) | PV Checklist 2023.pdf | 2024-03-08 12:52 | 69K | |
![[ ]](/icons/layout.gif) | 11-09-24 Exemptions on the Basis of Exceptional Circumstances.pdf | 2024-09-12 08:45 | 69K | |
![[TXT]](/icons/text.gif) | canva_jquery.bootstrap.js | 2023-12-05 09:50 | 70K | |
![[TXT]](/icons/text.gif) | canva_style-rtl.css | 2023-12-05 09:50 | 70K | |
![[ ]](/icons/layout.gif) | 24-06-24 CMS Sections Closing.pdf | 2024-06-25 09:45 | 70K | |
![[ ]](/icons/layout.gif) | Module Descriptors Open for Edit.pdf | 2024-04-23 09:16 | 71K | |
![[ ]](/icons/layout.gif) | Scholarships_and_Awards_Reports_available.pdf | 2023-12-05 09:50 | 72K | |
![[ ]](/icons/layout.gif) | Spring and Summer Module Edits Closing.pdf | 2024-04-23 09:16 | 72K | |
![[ ]](/icons/layout.gif) | Editing Majors Checklist 202425.pdf | 2024-03-08 12:52 | 73K | |
![[ ]](/icons/layout.gif) | Other Module Grades (further detail).pdf | 2024-12-13 14:43 | 73K | |
![[ ]](/icons/layout.gif) | Email to SMECs 150121.pdf | 2023-12-05 09:50 | 74K | |
![[ ]](/icons/layout.gif) | Spring_Trimester-Teaching_Arrangements_Jan_2021.pdf | 2023-12-05 09:50 | 74K | |
![[ ]](/icons/layout.gif) | UCD Applications Update September 2022 .pdf | 2023-12-05 09:50 | 74K | |
![[ ]](/icons/layout.gif) | 130325_Registry_update.pdf | 2025-03-13 15:44 | 76K | |
![[TXT]](/icons/text.gif) | bootstrap.bundle.min.js | 2024-03-08 12:52 | 76K | |
![[ ]](/icons/layout.gif) | ACCE Consideration 2907.pdf | 2023-12-05 09:50 | 77K | |
![[ ]](/icons/layout.gif) | 16-05-24 CMS - Sept Intake Arrangements for Edits and Changes to Requirements & Prior Learning.pdf | 2024-05-16 16:17 | 77K | |
![[ ]](/icons/layout.gif) | ACCE_MeetingDates_202526.pdf | 2025-03-26 13:43 | 77K | |
![[ ]](/icons/layout.gif) | Draft ACCE_MeetingDates_202526.pdf | 2025-03-26 11:43 | 77K | |
![[ ]](/icons/layout.gif) | 22_04_25_EditSummerModulesOpen.pdf | 2025-04-23 10:13 | 77K | |
![[ ]](/icons/layout.gif) | Summer Trimester 22_23 Paper Deadline to Schools.pdf | 2024-03-08 12:52 | 77K | |
![[ ]](/icons/unknown.gif) | PDARF3 New Programme Academic Structure Proposal_Final Oct SEPT 2021 DRAFT.docx | 2024-09-27 12:45 | 78K | |
![[ ]](/icons/layout.gif) | ExaminationChecklist 18.04.24.pdf | 2024-04-18 12:46 | 78K | |
![[IMG]](/icons/image2.gif) | kate.jpeg | 2024-03-08 12:52 | 79K | |
![[ ]](/icons/layout.gif) | Autumn 23-24 Exam Question Papers Portal.pdf | 2024-03-08 12:52 | 80K | |
![[IMG]](/icons/image2.gif) | joanna.jpeg | 2024-03-08 12:52 | 81K | |
![[ ]](/icons/layout.gif) | Structure Changes to Majors outside CMS Timelines.pdf | 2023-12-05 09:50 | 81K | |
![[IMG]](/icons/image2.gif) | Science_Stairs.jpg | 2024-03-08 12:52 | 81K | |
![[ ]](/icons/layout.gif) | 14_04_25_CMSCloseMayIntakeMajors.pdf | 2025-04-15 08:13 | 81K | |
![[IMG]](/icons/image2.gif) | canva_pattern2.png | 2023-12-05 09:50 | 81K | |
![[ ]](/icons/layout.gif) | Student_Degree_Audit_Report_available_in_InfoHub.pdf | 2023-12-05 09:50 | 81K | |
![[ ]](/icons/layout.gif) | Examination Checklist.pdf | 2024-03-08 12:52 | 81K | |
![[ ]](/icons/layout.gif) | 8. DRAFT- Spring Trimester 21_22 Paper Deadline to Schools 150222.pdf | 2023-12-05 09:50 | 82K | |
![[IMG]](/icons/image2.gif) | evan.jpeg | 2024-03-08 12:52 | 82K | |
![[IMG]](/icons/image2.gif) | susan.jpeg | 2024-03-08 13:20 | 82K | |
![[ ]](/icons/unknown.gif) | la-brands-400-1.woff2 | 2024-03-08 12:52 | 83K | |
![[ ]](/icons/unknown.gif) | la-brands-400.woff2 | 2025-02-20 15:43 | 83K | |
![[TXT]](/icons/text.gif) | bs-datatable.js | 2023-12-05 09:50 | 83K | |
![[TXT]](/icons/text.gif) | canva_bs-datatable.js | 2023-12-05 09:50 | 83K | |
![[ ]](/icons/layout.gif) | ELR-staff.pdf | 2024-03-08 12:52 | 83K | |
![[IMG]](/icons/image2.gif) | sarah.jpeg | 2024-03-08 12:52 | 84K | |
![[IMG]](/icons/image2.gif) | Final Stage only Award GPA calculation-552x617.png | 2024-12-13 14:43 | 84K | |
![[ ]](/icons/layout.gif) | tutordemonstatorformnew_updatedJan2023.pdf | 2023-12-05 09:50 | 84K | |
![[TXT]](/icons/text.gif) | canva_jquery.js | 2023-12-05 09:50 | 85K | |
![[IMG]](/icons/image2.gif) | Griffin_Kevin.jpg | 2024-03-08 12:52 | 85K | |
![[ ]](/icons/layout.gif) | Reminder to delete DD from SFAREGS.pdf | 2023-12-05 09:50 | 86K | |
![[ ]](/icons/layout.gif) | Examination Regulations.pdf | 2024-05-02 11:47 | 86K | |
![[ ]](/icons/unknown.gif) | Employee Fee Concession Form - new.docx | 2024-03-08 12:52 | 86K | |
![[ ]](/icons/unknown.gif) | Child of Employee Concession Form - new.docx | 2024-03-08 12:52 | 86K | |
![[ ]](/icons/layout.gif) | CompIntQual.pdf | 2023-12-05 09:50 | 86K | |
![[TXT]](/icons/text.gif) | choices.min.js | 2024-03-08 12:52 | 86K | |
![[IMG]](/icons/image2.gif) | jill.jpeg | 2024-03-08 12:52 | 87K | |
![[IMG]](/icons/image2.gif) | ruth.jpeg | 2024-03-08 12:52 | 87K | |
![[ ]](/icons/layout.gif) | Bulk_Upload_UniShare.pdf | 2023-12-05 09:50 | 87K | |
![[ ]](/icons/layout.gif) | Subject Considerations on Assessment 30.07.pdf | 2023-12-05 09:50 | 88K | |
![[ ]](/icons/unknown.gif) | Ubuntu-Medium.woff2 | 2024-03-08 12:52 | 88K | |
![[ ]](/icons/layout.gif) | Spring 2021 timetabling_staff_archive.pdf | 2023-12-05 09:50 | 88K | |
![[ ]](/icons/layout.gif) | Staff Email Autumn Trimester Exams, Final Arrangements.pdf | 2024-03-08 12:52 | 89K | |
![[ ]](/icons/unknown.gif) | Programme Approvals Financial Analysis Template.xlsx | 2024-09-25 15:15 | 89K | |
![[ ]](/icons/layout.gif) | NVB3.pdf | 2023-12-05 09:50 | 90K | |
![[ ]](/icons/layout.gif) | 20-12-23 CMS - Spring and Summer Module Edits Closing.pdf | 2024-03-08 12:52 | 90K | |
![[ ]](/icons/layout.gif) | 13-02-24 CMS - CMS Opening.pdf | 2024-03-08 12:52 | 90K | |
![[IMG]](/icons/image2.gif) | canva_lined-icons.svg | 2023-12-05 09:50 | 90K | |
![[ ]](/icons/layout.gif) | 10-10-24 Edits to January-intake Majors Open.pdf | 2024-10-11 08:46 | 91K | |
![[ ]](/icons/layout.gif) | Grade Entry is now live.pdf | 2023-12-05 09:50 | 91K | |
![[ ]](/icons/layout.gif) | Alert_Sep_2020.pdf | 2023-12-05 09:50 | 91K | |
![[IMG]](/icons/image2.gif) | ciara.jpeg | 2024-03-08 12:52 | 91K | |
![[ ]](/icons/layout.gif) | Admissions_2019.pdf | 2024-03-08 12:52 | 91K | |
![[ ]](/icons/layout.gif) | 29-11-24 Edits to January Intake Majors Closing.pdf | 2024-11-29 10:12 | 93K | |
![[TXT]](/icons/text.gif) | canva_bs-filestyle.js | 2023-12-05 09:50 | 93K | |
![[ ]](/icons/layout.gif) | exceptional grade email.pdf | 2023-12-05 09:50 | 93K | |
![[ ]](/icons/layout.gif) | 22_04_25_CMS_ClosingFor202500SeptMajors.pdf | 2025-04-23 10:13 | 93K | |
![[ ]](/icons/layout.gif) | 12-10-23 CMS - Edits to January-intake Majors Open.pdf | 2024-03-08 12:52 | 94K | |
![[ ]](/icons/layout.gif) | Alert_Mar2020.pdf | 2023-12-05 09:50 | 94K | |
![[TXT]](/icons/text.gif) | canva_typehead.js | 2023-12-05 09:50 | 94K | |
![[ ]](/icons/layout.gif) | UCD Module Grade Descriptors-1.pdf | 2024-03-08 12:52 | 94K | |
![[ ]](/icons/layout.gif) | UCD Module Grade Descriptors-2.pdf | 2025-01-10 11:13 | 94K | |
![[ ]](/icons/layout.gif) | UCD Module Grade Descriptors.pdf | 2023-12-05 09:50 | 94K | |
![[ ]](/icons/unknown.gif) | la-solid-900-1.woff2 | 2024-03-08 12:52 | 94K | |
![[ ]](/icons/unknown.gif) | la-solid-900.woff2 | 2025-02-20 15:43 | 94K | |
![[ ]](/icons/layout.gif) | 19-12-24 Spring and Summer Module Descriptor Edits Closing.pdf | 2024-12-20 09:12 | 95K | |
![[ ]](/icons/layout.gif) | Useful_Banner_Forms.pdf | 2025-02-20 13:09 | 95K | |
![[IMG]](/icons/image2.gif) | Resit remediation gradescales.jpg | 2025-02-25 12:39 | 96K | |
![[ ]](/icons/layout.gif) | Curriculum Management Reports Checklist 202425.pdf | 2024-03-08 12:52 | 96K | |
![[ ]](/icons/layout.gif) | Week_Ranges_2024_2025.pdf | 2024-08-07 10:45 | 96K | |
![[ ]](/icons/unknown.gif) | la-brands-400-1.woff | 2024-03-08 12:52 | 96K | |
![[ ]](/icons/unknown.gif) | la-brands-400.woff | 2025-02-20 15:43 | 96K | |
![[ ]](/icons/layout.gif) | Module List Management Timelines 202526.pdf | 2025-01-29 15:13 | 97K | |
![[ ]](/icons/layout.gif) | GAP Changes and Gradebook Replacement Project.pdf | 2023-12-05 09:50 | 97K | |
![[IMG]](/icons/image2.gif) | exceptionalgrade_clip_image002.png | 2023-12-05 09:50 | 97K | |
![[ ]](/icons/layout.gif) | OAProtocols.pdf | 2024-03-08 12:52 | 97K | |
![[ ]](/icons/unknown.gif) | Ubuntu-Regular.woff2 | 2024-03-08 12:52 | 97K | |
![[ ]](/icons/layout.gif) | 03-07-23 CMS - Update Module Descriptor Edit in July & Aug.pdf | 2024-03-08 12:52 | 97K | |
![[ ]](/icons/layout.gif) | 21-11-24 Edits to Spring and Summer Modules open.pdf | 2024-11-21 12:42 | 98K | |
![[ ]](/icons/layout.gif) | CMS Edits to May-intake Majors Open.pdf | 2024-04-04 10:47 | 98K | |
![[ ]](/icons/layout.gif) | Major & Programme MLM Edit Timelines 2023-24.pdf | 2023-12-05 09:50 | 98K | |
![[ ]](/icons/layout.gif) | 2. 18 February Spring Trimester, Exam Question Papers Staff Email tagged.pdf | 2025-02-18 12:09 | 98K | |
![[ ]](/icons/layout.gif) | 02-09-24 Module and Major Edits Closing.pdf | 2024-09-02 15:45 | 98K | |
![[ ]](/icons/layout.gif) | Curriculum Reporting on InfoHub.pdf | 2023-12-05 09:50 | 100K | |
![[ ]](/icons/layout.gif) | Major & Programme MLM Edit Timelines 2024-25.pdf | 2024-03-08 12:52 | 100K | |
![[TXT]](/icons/text.gif) | fancybox.umd.js | 2024-03-08 12:52 | 101K | |
![[ ]](/icons/layout.gif) | RORAP.pdf | 2024-03-08 12:52 | 101K | |
![[ ]](/icons/layout.gif) | ExaminationChecklist.pdf | 2024-05-02 12:17 | 101K | |
![[ ]](/icons/layout.gif) | Grade Entry and approval timelines for the Spring 2022-23 Grade Approvals Process.pdf | 2024-03-08 12:52 | 102K | |
![[ ]](/icons/layout.gif) | Programme-Structures_2019.pdf | 2024-03-08 12:52 | 103K | |
![[ ]](/icons/layout.gif) | UCD Level Codes and NFQ Levels.pdf | 2023-12-05 09:50 | 103K | |
![[ ]](/icons/layout.gif) | PV Checklist 2024.pdf | 2024-07-01 16:15 | 104K | |
![[ ]](/icons/layout.gif) | QCAS Applicant User Guide for UCD.pdf | 2023-12-05 09:50 | 105K | |
![[ ]](/icons/layout.gif) | Academic_Calendars2024_25.pdf | 2024-05-30 12:47 | 105K | |
![[ ]](/icons/layout.gif) | Spring&Summer Module Places Closing 201221.pdf | 2023-12-05 09:50 | 105K | |
![[ ]](/icons/layout.gif) | Final Summer Trimester 202021 0307.pdf | 2023-12-05 09:50 | 106K | |
![[ ]](/icons/layout.gif) | Brightspace Grade Transfer Issue 200521.pdf | 2023-12-05 09:50 | 106K | |
![[ ]](/icons/layout.gif) | 27-06-23 CMS - Edits to Student Effort Hours & Credit Split by Trimester Closing.pdf | 2024-03-08 12:52 | 107K | |
![[ ]](/icons/layout.gif) | 14-02-24 CMS - Module Descriptors Open for Edit.pdf | 2024-03-08 12:52 | 107K | |
![[ ]](/icons/layout.gif) | 27-06-23 CMS - Module Trimester & Status Closing 30 June.pdf | 2024-03-08 12:52 | 107K | |
![[ ]](/icons/layout.gif) | 03-07-23 CMS - Final Module Trimester & Status Edits.pdf | 2024-03-08 12:52 | 107K | |
![[ ]](/icons/layout.gif) | UCD Subject Extern Examiners 2020.21.pdf | 2023-12-05 09:50 | 108K | |
![[ ]](/icons/layout.gif) | 2023 Guidelines for Programme Verification.pdf | 2024-03-08 12:52 | 108K | |
![[ ]](/icons/unknown.gif) | Supporting_Information_Template.docx | 2023-12-05 09:50 | 108K | |
![[ ]](/icons/layout.gif) | Final Changes to Module Descriptors Major Structures.pdf | 2024-04-23 09:16 | 108K | |
![[ ]](/icons/layout.gif) | Student-Registration-and-Services_2019.pdf | 2024-03-08 12:52 | 109K | |
![[IMG]](/icons/image2.gif) | Component Grades image-998x1113.PNG | 2024-12-13 14:43 | 109K | |
![[ ]](/icons/layout.gif) | GAP Feedback Survey.pdf | 2023-12-05 09:50 | 109K | |
![[ ]](/icons/layout.gif) | Deferral-Protocol.pdf | 2024-07-17 15:48 | 109K | |
![[ ]](/icons/layout.gif) | Module Descriptor Edit Timelines 2024-25.pdf | 2024-03-08 12:52 | 110K | |
![[ ]](/icons/layout.gif) | Module Descriptor Edit Timelines 202425.pdf | 2024-01-31 13:22 | 110K | |
![[ ]](/icons/layout.gif) | 11-30-23 CMS - Edits to January-intake Majors Closing.pdf | 2024-03-08 12:52 | 110K | |
![[ ]](/icons/layout.gif) | AlertOct2021.pdf | 2023-12-05 09:50 | 110K | |
![[ ]](/icons/layout.gif) | Gradebook Replacement Project HTML 2109.pdf | 2023-12-05 09:50 | 111K | |
![[ ]](/icons/layout.gif) | Important GAP Update 19012021.pdf | 2023-12-05 09:50 | 111K | |
![[IMG]](/icons/image2.gif) | University Awards table.PNG | 2024-12-13 14:43 | 111K | |
![[ ]](/icons/layout.gif) | Update Language Preferences for Chrome.pdf | 2023-12-04 16:18 | 111K | |
![[IMG]](/icons/image2.gif) | la-regular-400-1.svg | 2024-03-08 12:52 | 111K | |
![[IMG]](/icons/image2.gif) | la-regular-400.svg | 2025-02-20 15:43 | 111K | |
![[ ]](/icons/layout.gif) | Spring Summer Module Edits Closing 040122.pdf | 2023-12-05 09:50 | 111K | |
![[ ]](/icons/layout.gif) | UCD Applications Update Oct 2021 for website.pdf | 2023-12-05 09:50 | 111K | |
![[ ]](/icons/layout.gif) | Update for Module Coordinators 2022-23 Spring and Summer Module Edits Closing.pdf | 2024-03-08 12:52 | 111K | |
![[ ]](/icons/layout.gif) | Alert_Sep_2022.pdf | 2024-03-08 12:52 | 112K | |
![[ ]](/icons/layout.gif) | Summer Module Edits Open 260422.pdf | 2023-12-05 09:50 | 112K | |
![[ ]](/icons/layout.gif) | 12-12-25 CMS Open for Edits.pdf | 2025-02-12 23:42 | 113K | |
![[ ]](/icons/layout.gif) | Assessment-for-modules_2019.pdf | 2024-03-08 12:52 | 113K | |
![[ ]](/icons/layout.gif) | Easy Steps for Extern Examiners on Website 2 July 2021.pptx (2).pdf | 2024-03-08 12:52 | 113K | |
![[ ]](/icons/layout.gif) | Module Exemption Checklist 202324.pdf | 2024-03-08 12:52 | 113K | |
![[ ]](/icons/layout.gif) | Module Descriptor Edit Timelines 2023-24.pdf | 2023-12-05 09:50 | 113K | |
![[ ]](/icons/layout.gif) | Autumn Trimester Examinations.pdf | 2023-12-05 09:50 | 114K | |
![[ ]](/icons/layout.gif) | information feedback session.pdf | 2023-12-05 09:50 | 114K | |
![[ ]](/icons/layout.gif) | Brightspace Grade Transfer Issue RESOLVED 200521.pdf | 2023-12-05 09:50 | 114K | |
![[ ]](/icons/layout.gif) | Module Descriptor edit timelines.pdf | 2025-01-29 12:44 | 114K | |
![[ ]](/icons/unknown.gif) | PDARF2 New Programme Proposal (UMT)_Final June 2019.docx | 2024-03-08 12:52 | 114K | |
![[ ]](/icons/layout.gif) | Alert Sep 2024.pdf | 2024-10-03 09:16 | 114K | |
![[ ]](/icons/layout.gif) | 23-08-24 IMPL Assessment Strategy Changes.pdf | 2024-08-26 10:45 | 114K | |
![[ ]](/icons/layout.gif) | Module Descriptor Edit Timelines 202526.pdf | 2025-02-12 23:42 | 115K | |
![[ ]](/icons/layout.gif) | STAff email covid 1911.pdf | 2023-12-05 09:50 | 115K | |
![[IMG]](/icons/image2.gif) | Module Remediation Timing-888x659.png | 2024-12-13 14:43 | 115K | |
![[IMG]](/icons/image2.gif) | moduleteachingarrangement.png | 2024-03-08 12:52 | 115K | |
![[ ]](/icons/layout.gif) | Staff email 081221.html.pdf | 2023-12-05 09:50 | 115K | |
![[IMG]](/icons/image2.gif) | pagetitle-bgd-1600w1000h.jpg | 2023-12-05 09:50 | 115K | |
![[ ]](/icons/layout.gif) | Major Edit Timelines 202526.pdf | 2025-01-29 15:13 | 115K | |
![[ ]](/icons/layout.gif) | Standard Conversion Grade Scale.pdf | 2024-03-08 12:52 | 116K | |
![[ ]](/icons/layout.gif) | Financial-Arrangements-incFees_2019.pdf | 2024-03-08 12:52 | 116K | |
![[ ]](/icons/unknown.gif) | Ubuntu-Medium.woff | 2024-03-08 12:52 | 116K | |
![[ ]](/icons/layout.gif) | RPL Applications System Enhancements.pdf | 2023-12-05 09:50 | 116K | |
![[ ]](/icons/layout.gif) | Staff AC Update 261121.pdf | 2023-12-05 09:50 | 117K | |
![[ ]](/icons/layout.gif) | Easy Steps for Extern Examiners on Website 25 May 2023.pptx (3).pdf | 2024-03-08 12:52 | 117K | |
![[ ]](/icons/layout.gif) | Grade Approvals Process Revised Key Dates.pdf | 2023-12-05 09:50 | 117K | |
![[ ]](/icons/layout.gif) | GAP email to MC.pdf | 2023-12-05 09:50 | 117K | |
![[ ]](/icons/layout.gif) | Staff fee concession form.pdf | 2023-12-05 09:50 | 118K | |
![[ ]](/icons/layout.gif) | Required_Information_for_Special_Extern_Examiner_Nomination.pdf | 2024-03-14 13:49 | 118K | |
![[TXT]](/icons/text.gif) | canva_jquery.swiper.js | 2023-12-05 09:50 | 118K | |
![[ ]](/icons/layout.gif) | How_to_log_into_Banner_July_2022.pdf | 2023-12-05 09:50 | 119K | |
![[IMG]](/icons/image2.gif) | Registry staff group photo_15May24-1016x718.jpg | 2024-07-02 11:15 | 119K | |
![[ ]](/icons/layout.gif) | Resit Exam Registration Email.pdf | 2024-10-25 12:17 | 119K | |
![[ ]](/icons/layout.gif) | PDARF FLOW CHART FEB 2023-1.pdf | 2023-12-06 12:18 | 119K | |
![[ ]](/icons/layout.gif) | PDARF FLOW CHART FEB 2023.pdf | 2023-12-04 14:20 | 119K | |
![[ ]](/icons/layout.gif) | Subject Extern Examiner Survey.pdf | 2023-12-05 09:50 | 120K | |
![[ ]](/icons/layout.gif) | Gradebook Replacement Project - Grade Entry Live Demo Booking Form.pdf | 2023-12-05 09:50 | 120K | |
![[ ]](/icons/layout.gif) | September-intake Major Structures PDARF16 130921.pdf | 2023-12-05 09:50 | 120K | |
![[ ]](/icons/layout.gif) | Privacy Policy for Extern Examiners draft 4.pdf | 2024-03-08 12:52 | 120K | |
![[ ]](/icons/layout.gif) | Spring Trimester Draft Timetable 010322.pdf | 2023-12-05 09:50 | 120K | |
![[ ]](/icons/layout.gif) | Email to all staff on eThesis.pdf | 2023-12-05 09:50 | 120K | |
![[ ]](/icons/layout.gif) | CMS Opening.pdf | 2024-04-23 09:16 | 121K | |
![[ ]](/icons/layout.gif) | Staff Exam Question Papers Submission Deadline.pdf | 2024-03-08 12:52 | 121K | |
![[IMG]](/icons/image2.gif) | Invigilator Advert (1)-489x692.png | 2023-12-05 09:50 | 121K | |
![[ ]](/icons/layout.gif) | STAFF Spring Exam Arrangements Email 270422.pdf | 2023-12-05 09:50 | 122K | |
![[ ]](/icons/layout.gif) | timetable.html.pdf | 2023-12-05 09:50 | 122K | |
![[ ]](/icons/layout.gif) | Details of Practical Experience.pdf | 2024-03-08 12:52 | 122K | |
![[ ]](/icons/layout.gif) | Spring Trimester GAP Survey.pdf | 2023-12-05 09:50 | 122K | |
![[ ]](/icons/layout.gif) | Application Appeals form.pdf | 2024-04-30 12:17 | 122K | |
![[ ]](/icons/layout.gif) | GAP email to HOS.pdf | 2023-12-05 09:50 | 122K | |
![[ ]](/icons/unknown.gif) | la-solid-900-1.woff | 2024-03-08 12:52 | 122K | |
![[ ]](/icons/unknown.gif) | la-solid-900.woff | 2025-02-20 15:43 | 122K | |
![[ ]](/icons/layout.gif) | 2022 MC Wufoo 160522.pdf | 2023-12-05 09:49 | 123K | |
![[ ]](/icons/layout.gif) | Staff Exams FAQ email 231121.pdf | 2023-12-05 09:50 | 123K | |
![[ ]](/icons/layout.gif) | Curriculum Management Reports Checklist.pdf | 2025-02-07 16:39 | 123K | |
![[ ]](/icons/layout.gif) | PDARF FLOW CHART.pdf | 2024-11-27 16:12 | 123K | |
![[ ]](/icons/layout.gif) | Curriculum Management Reports Checklist 202526.pdf | 2025-02-10 15:39 | 123K | |
![[ ]](/icons/layout.gif) | UCD Applications System update July 2022.pdf | 2023-12-05 09:50 | 123K | |
![[ ]](/icons/layout.gif) | gdpr-data-retention.pdf | 2023-12-05 09:50 | 124K | |
![[ ]](/icons/layout.gif) | Checking student information_UView_InfoHub.pdf | 2024-03-08 12:52 | 125K | |
![[ ]](/icons/layout.gif) | UCD Applications Update September 2023 .pdf | 2024-03-08 12:52 | 125K | |
![[ ]](/icons/layout.gif) | Admissions_revised_2024.pdf | 2024-11-29 12:12 | 126K | |
![[ ]](/icons/layout.gif) | Autumn Trimester, Draft Exam Timetable Staff Email.pdf | 2024-10-25 12:17 | 126K | |
![[ ]](/icons/unknown.gif) | Ubuntu-Regular.woff | 2024-03-08 12:52 | 126K | |
![[ ]](/icons/layout.gif) | Summer Exam Session Key Dates 21 Jan.pdf | 2025-01-21 12:43 | 126K | |
![[ ]](/icons/layout.gif) | 2022 School College Module Places 250722.pdf | 2023-12-05 09:49 | 127K | |
![[ ]](/icons/layout.gif) | Banner_frequently_used_shortcuts.pdf | 2025-02-13 13:10 | 127K | |
![[ ]](/icons/layout.gif) | Summer Trimester Exam Dates 2023.pdf | 2024-03-08 12:52 | 127K | |
![[ ]](/icons/layout.gif) | Privacy Policy for Invigilators-Updated February 2025 (1).pdf | 2025-04-22 15:13 | 127K | |
![[ ]](/icons/layout.gif) | 2022 MC SEH Credit Split Closing 270622.pdf | 2023-12-05 09:49 | 127K | |
![[ ]](/icons/layout.gif) | 2022 MC Prior Learning Closing 090522.pdf | 2023-12-05 09:49 | 127K | |
![[ ]](/icons/layout.gif) | Edits to January-intake Majors Open 141021.pdf | 2023-12-05 09:50 | 127K | |
![[ ]](/icons/layout.gif) | 2022 School College May Edits Open 140323.pdf | 2024-03-08 12:52 | 128K | |
![[ ]](/icons/layout.gif) | 2022 School College Module Status Trimester Closing 270622.pdf | 2023-12-05 09:49 | 128K | |
![[ ]](/icons/layout.gif) | Edits to May-intake Majors Open150322.pdf | 2023-12-05 09:50 | 128K | |
![[ ]](/icons/layout.gif) | Spring Trimester, Online Scheduled Timed Examinations Draft Timetable 1803.pdf | 2023-12-05 09:50 | 128K | |
![[ ]](/icons/layout.gif) | UK National Marking and Assessment Boycott.pdf | 2024-03-08 12:52 | 128K | |
![[ ]](/icons/layout.gif) | 2022 School College Jan Edits Open 131022.pdf | 2024-03-08 12:52 | 128K | |
![[TXT]](/icons/text.gif) | canva_moment.js | 2023-12-05 09:50 | 128K | |
![[ ]](/icons/layout.gif) | Exam Portal Open 1 Oct 24.pdf | 2024-10-01 10:45 | 129K | |
![[ ]](/icons/layout.gif) | 2022 School College Wufoo 040722.pdf | 2023-12-05 09:49 | 129K | |
![[ ]](/icons/layout.gif) | 2022 MCs Edits Open 080222.pdf | 2023-12-05 09:49 | 130K | |
![[TXT]](/icons/text.gif) | canva_functions.js | 2023-12-05 09:50 | 130K | |
![[ ]](/icons/layout.gif) | Joint Degree Report Guidelines-1.pdf | 2024-03-08 12:52 | 130K | |
![[ ]](/icons/layout.gif) | Joint Degree Report Guidelines-2.pdf | 2024-10-21 14:18 | 130K | |
![[ ]](/icons/layout.gif) | Joint Degree Report Guidelines.pdf | 2023-12-04 14:20 | 130K | |
![[ ]](/icons/layout.gif) | Module Descriptors Open for Academic Year 2023-24 Edits.pdf | 2024-03-08 12:52 | 131K | |
![[ ]](/icons/layout.gif) | UK National Marking and Assessment Boycott update.pdf | 2024-03-08 12:52 | 131K | |
![[ ]](/icons/layout.gif) | Assessment Email Contacts.pdf | 2025-01-13 11:12 | 131K | |
![[ ]](/icons/layout.gif) | Edits January-intake Majors Closing 061221.pdf | 2023-12-05 09:50 | 131K | |
![[ ]](/icons/layout.gif) | RPL staff communication September 1st 2021.pdf | 2023-12-05 09:50 | 131K | |
![[ ]](/icons/layout.gif) | UCD_IT_Access_Jan_24.pdf | 2025-04-02 09:43 | 132K | |
![[ ]](/icons/layout.gif) | Edits to May-intake Majors Closing 190422.pdf | 2023-12-05 09:50 | 133K | |
![[ ]](/icons/layout.gif) | Grade Approvals Process Reminder- Training & Support.pdf | 2023-12-05 09:50 | 133K | |
![[ ]](/icons/layout.gif) | 2024 Guidelines for Programme Verification.pdf | 2024-07-01 14:15 | 133K | |
![[ ]](/icons/layout.gif) | Jan Majors Closing Schools Colleges 061222.pdf | 2024-03-08 12:52 | 134K | |
![[IMG]](/icons/image2.gif) | business_analyst.jpg | 2024-03-08 12:52 | 134K | |
![[ ]](/icons/layout.gif) | Supervisor Checklist 08 Nov 2021.pptx.pdf | 2024-03-08 12:52 | 134K | |
![[ ]](/icons/layout.gif) | 2022 MCs Spring Summer Mods Open 241122.pdf | 2024-03-08 12:52 | 134K | |
![[ ]](/icons/layout.gif) | Award-Classification_2019.pdf | 2024-03-08 12:52 | 136K | |
![[ ]](/icons/layout.gif) | Upgrade complete_archive.pdf | 2023-12-05 09:50 | 136K | |
![[ ]](/icons/layout.gif) | 2022 MC Wufoo 040722.pdf | 2023-12-05 09:49 | 136K | |
![[ ]](/icons/layout.gif) | 2022 School College Wufoo 160522.pdf | 2023-12-05 09:49 | 138K | |
![[ ]](/icons/layout.gif) | Update for Schools_Colleges 2022-23 Spring and Summer Module Edits Closing.pdf | 2024-03-08 12:52 | 140K | |
![[ ]](/icons/layout.gif) | 2022 School College Edits Open 080222.pdf | 2023-12-05 09:49 | 140K | |
![[ ]](/icons/layout.gif) | Follow on - exams manager email..pdf | 2023-12-05 09:50 | 141K | |
![[ ]](/icons/layout.gif) | Exemptions 2022 120922.pdf | 2024-03-08 12:52 | 141K | |
![[ ]](/icons/layout.gif) | 2022 MC Descriptor Closing 050922.pdf | 2024-03-08 12:52 | 141K | |
![[ ]](/icons/layout.gif) | 2022 School College Edits Closing 090522.pdf | 2023-12-05 09:49 | 141K | |
![[ ]](/icons/layout.gif) | Summer Draft Timetable staff email.html.pdf | 2024-03-08 12:52 | 142K | |
![[ ]](/icons/layout.gif) | CMS open for 2023-24.pdf | 2024-03-08 12:52 | 142K | |
![[ ]](/icons/layout.gif) | UCD Past Examination Paper Archive 1705.pdf | 2023-12-05 09:50 | 143K | |
![[TXT]](/icons/text.gif) | swiper-bundle.min.js | 2024-03-08 12:52 | 143K | |
![[ ]](/icons/layout.gif) | Module Descriptor Checklist .pdf | 2025-02-07 16:39 | 143K | |
![[ ]](/icons/layout.gif) | Autumn Draft Timetable STAFF.pdf | 2024-03-08 12:52 | 143K | |
![[ ]](/icons/layout.gif) | Major & Module List Mgmt Edit Timelines 202425.pdf | 2024-05-01 10:46 | 144K | |
![[ ]](/icons/layout.gif) | Major & Programme MLM Edit Timelines 2024-25-1.pdf | 2024-04-30 15:18 | 144K | |
![[ ]](/icons/layout.gif) | eThesis Joint Degree Report Structure and Guidance 22.09.21.pdf | 2023-12-05 09:50 | 145K | |
![[ ]](/icons/layout.gif) | Autumn Trimester Draft Timetable.html.pdf | 2023-12-05 09:50 | 145K | |
![[ ]](/icons/layout.gif) | Spring Draft Timetable staff email.html.pdf | 2024-03-08 12:52 | 145K | |
![[ ]](/icons/layout.gif) | 2022 School_College Spring Summer Mods Open 241122.pdf | 2024-03-08 12:52 | 145K | |
![[ ]](/icons/layout.gif) | Major & Programme MLM Edit Timelines 202425 C&S.pdf | 2024-10-10 11:15 | 145K | |
![[ ]](/icons/layout.gif) | Major & Programme MLM Edit Timelines 202425.pdf | 2024-05-16 07:47 | 145K | |
![[ ]](/icons/layout.gif) | 04-09-23 CMS - Final Changes to Module Descriptors Major Structures.pdf | 2024-03-08 12:52 | 145K | |
![[ ]](/icons/layout.gif) | Grad Entry Vet Med Guidelines.pdf | 2024-03-14 12:50 | 145K | |
![[ ]](/icons/layout.gif) | Spring Trimester, Draft Exam Timetable.pdf | 2025-02-25 10:39 | 146K | |
![[ ]](/icons/layout.gif) | University College Dublin Mail - Exams Manager Issue - Now Resolved.pdf | 2024-03-08 12:52 | 146K | |
![[ ]](/icons/layout.gif) | Clear_browser_data_Chrome.pdf | 2025-02-20 13:39 | 146K | |
![[IMG]](/icons/image2.gif) | Screenshot 2024-12-16 at 15.23.27.png | 2024-12-16 17:12 | 147K | |
![[ ]](/icons/layout.gif) | STAFF Summer Exam Arrangements Email 290622.pdf | 2023-12-05 09:50 | 147K | |
![[ ]](/icons/layout.gif) | 2022 School_College Structures & Descriptor Closing 050922.pdf | 2024-03-08 12:52 | 148K | |
![[ ]](/icons/layout.gif) | Module Descriptor Edit Timelines 202425 - with updated wufoo link.pdf | 2024-07-01 07:45 | 148K | |
![[ ]](/icons/layout.gif) | Spring Trimester, Online Scheduled Timed Examinations 010321.pdf | 2023-12-05 09:50 | 148K | |
![[ ]](/icons/layout.gif) | Module Descriptor Edit Timelines 2024-25-1.pdf | 2024-11-19 13:44 | 148K | |
![[ ]](/icons/layout.gif) | Edits to Majors_Prior Learning & Module Places Closing.pdf | 2024-05-10 09:16 | 148K | |
![[ ]](/icons/layout.gif) | Answer sheet type 3 True False Unanswered (up to 20Q) Code S3233.pdf | 2024-03-08 12:52 | 148K | |
![[ ]](/icons/layout.gif) | Applicant-Complaints.pdf | 2023-12-05 09:50 | 149K | |
![[ ]](/icons/layout.gif) | Module Descriptor Checklist 202425.pdf | 2024-03-08 12:52 | 149K | |
![[ ]](/icons/layout.gif) | Checking_student_information_UView_InfoHub.pdf | 2024-03-08 12:52 | 149K | |
![[ ]](/icons/layout.gif) | Academic Council Committee on Examinations (ACCE) Update 241120.pdf | 2023-12-05 09:50 | 151K | |
![[ ]](/icons/layout.gif) | Exams Manager Launch.pdf | 2023-12-05 09:50 | 152K | |
![[ ]](/icons/layout.gif) | Resit Exam Registration Autumn 23-24.pdf | 2024-03-08 12:52 | 152K | |
![[ ]](/icons/layout.gif) | How_to_log_into_Banner_Jan_24.pdf | 2025-02-13 13:10 | 152K | |
![[ ]](/icons/unknown.gif) | la-brands-400-1.ttf | 2024-03-08 12:52 | 152K | |
![[ ]](/icons/unknown.gif) | la-brands-400.ttf | 2025-02-20 15:43 | 152K | |
![[ ]](/icons/unknown.gif) | la-brands-400-1.eot | 2024-03-08 12:52 | 153K | |
![[ ]](/icons/unknown.gif) | la-brands-400.eot | 2025-02-20 15:43 | 153K | |
![[ ]](/icons/layout.gif) | Module Descriptor Checklist.pdf | 2024-05-03 11:47 | 153K | |
![[ ]](/icons/unknown.gif) | Exceptional Grade Change Request Form.doc | 2023-12-05 09:50 | 155K | |
![[ ]](/icons/layout.gif) | Checklist.pdf | 2023-12-05 09:50 | 156K | |
![[ ]](/icons/layout.gif) | Exams Manager Issue - Notification Emails are not being sent.pdf | 2024-03-08 12:52 | 156K | |
![[ ]](/icons/layout.gif) | CAO Selection.pdf | 2025-04-23 10:44 | 157K | |
![[ ]](/icons/layout.gif) | Final Changes to ModulesMajor Structures 060921.pdf | 2023-12-05 09:50 | 158K | |
![[ ]](/icons/layout.gif) | Staff email 061221.html.pdf | 2023-12-05 09:50 | 158K | |
![[ ]](/icons/layout.gif) | Staff paper thesis submission discontinued.pdf | 2023-12-05 09:50 | 159K | |
![[ ]](/icons/unknown.gif) | canva_font-icons.ttf | 2023-12-05 09:50 | 160K | |
![[ ]](/icons/unknown.gif) | canva_font-icons.woff | 2023-12-05 09:50 | 160K | |
![[ ]](/icons/unknown.gif) | canva_font-icons.eot | 2023-12-05 09:50 | 160K | |
![[ ]](/icons/layout.gif) | SSASECQ screen Banner 9.pdf | 2024-03-08 12:52 | 161K | |
![[ ]](/icons/layout.gif) | Staff Email 6 July 2021 Draft Exam TT.pdf | 2023-12-05 09:50 | 161K | |
![[ ]](/icons/layout.gif) | Autumn Trimester, Examinations Draft Timetable.pdf | 2024-03-08 12:52 | 162K | |
![[ ]](/icons/layout.gif) | Change_to_Resit_Fee_23_24.pdf | 2024-03-08 12:52 | 162K | |
![[ ]](/icons/layout.gif) | Editing Major Structures Checklist.pdf | 2025-02-07 16:39 | 163K | |
![[TXT]](/icons/text.gif) | canva_bootstrap.css | 2023-12-05 09:50 | 163K | |
![[ ]](/icons/layout.gif) | Module Exemption Checklist.pdf | 2024-05-03 11:47 | 165K | |
![[ ]](/icons/layout.gif) | Assessment-for-modules_revised_2024.pdf | 2024-11-29 12:12 | 165K | |
![[ ]](/icons/layout.gif) | Answer sheet type 1 ABCDE (up to 120Q) Code S3231.pdf | 2024-03-08 12:52 | 165K | |
![[ ]](/icons/layout.gif) | Module Exemption Checklist .pdf | 2025-02-07 16:39 | 165K | |
![[ ]](/icons/layout.gif) | Programme-Structures_revised_2024.pdf | 2024-11-29 12:12 | 165K | |
![[ ]](/icons/layout.gif) | Staff Autumn Exam Arrangements 2022.pdf | 2024-03-08 12:52 | 166K | |
![[ ]](/icons/layout.gif) | CAO-Selection.pdf | 2024-03-08 12:52 | 167K | |
![[ ]](/icons/layout.gif) | Edits to January-intake Majors Open.pdf | 2024-04-23 09:16 | 167K | |
![[IMG]](/icons/image2.gif) | Image of Hardbound Thesis.png | 2025-03-24 15:44 | 168K | |
![[IMG]](/icons/image2.gif) | Theses Pic the thesis centre.png | 2025-03-24 15:44 | 168K | |
![[IMG]](/icons/image2.gif) | Approval of Final Revised Thesis.png | 2025-03-24 15:44 | 168K | |
![[ ]](/icons/layout.gif) | Answer sheet type 4 True False Don't Know (up to 60Q) Code S3232.pdf | 2024-03-08 12:52 | 169K | |
![[ ]](/icons/layout.gif) | Major Structure Review Checklist.pdf | 2025-02-07 16:39 | 169K | |
![[IMG]](/icons/image2.gif) | study-1.jpg | 2025-03-24 12:43 | 169K | |
![[IMG]](/icons/image2.gif) | study-5.jpg | 2024-12-04 13:12 | 169K | |
![[ ]](/icons/layout.gif) | 2023 Programme Verification using JIRA.pdf | 2024-03-08 12:52 | 169K | |
![[ ]](/icons/layout.gif) | Student-Registration-and-Services_revised_2024.pdf | 2024-11-29 12:12 | 170K | |
![[ ]](/icons/layout.gif) | Edits to January-intake Majors Closing.pdf | 2024-04-23 09:16 | 171K | |
![[ ]](/icons/layout.gif) | External Reporting_2024.pdf | 2024-12-12 12:13 | 171K | |
![[ ]](/icons/unknown.gif) | Change of Examination Committee Chair Form 2021.docx | 2024-03-08 12:52 | 172K | |
![[ ]](/icons/layout.gif) | Editing Majors Checklist.pdf | 2024-05-03 11:47 | 172K | |
![[ ]](/icons/unknown.gif) | Change of Examination Committee Intern Form 2021.docx | 2024-03-08 12:52 | 173K | |
![[ ]](/icons/layout.gif) | Formal-Agreements_2019.pdf | 2024-03-08 12:52 | 174K | |
![[IMG]](/icons/image2.gif) | canva_Simple-Line-Icons.svg | 2023-12-05 09:50 | 175K | |
![[ ]](/icons/layout.gif) | Module Access Management Checklist-1.pdf | 2024-05-08 11:47 | 176K | |
![[ ]](/icons/layout.gif) | Award-Classification_revised_2024.pdf | 2024-11-29 12:12 | 176K | |
![[ ]](/icons/unknown.gif) | Extern Examiner Fee Claim Form as of 1 March 2022-1.docx | 2024-10-21 14:18 | 177K | |
![[ ]](/icons/unknown.gif) | Extern Examiner Fee Claim Form as of 1 March 2022.docx | 2024-03-08 12:52 | 177K | |
![[ ]](/icons/layout.gif) | Collaborative-Award-Types-taxonomies-and-Established-Routes-for-Collaboration_2019.pdf | 2024-03-08 12:52 | 177K | |
![[ ]](/icons/unknown.gif) | Extern Examiner Expense Claim Form as of 1 March 2022 (2) (13).docx | 2024-03-08 12:52 | 178K | |
![[ ]](/icons/layout.gif) | Update_a_stage_for_a_module_via_InfoHub_2022.pdf | 2023-12-05 09:50 | 178K | |
![[ ]](/icons/unknown.gif) | Extern_Examiner_ Expense_Claim_Form_as_of_1_March_2022_190624.docx | 2024-06-19 20:14 | 178K | |
![[ ]](/icons/unknown.gif) | 250924_Updated_Extern_Examiner_Expense_Claim_Form_as_of_1_March_2022.docx | 2024-09-25 16:15 | 178K | |
![[IMG]](/icons/image2.gif) | pattern-white.svg | 2024-03-08 12:52 | 178K | |
![[IMG]](/icons/image2.gif) | canva_Simple-Line-Icons.dev.svg | 2023-12-05 09:50 | 178K | |
![[ ]](/icons/unknown.gif) | 250924_Updated_Extern_Examiner_Fee_Claim_Form_as_of_1_March_2022.docx | 2024-09-26 14:45 | 178K | |
![[ ]](/icons/layout.gif) | Financial-Arrangements-incFees_revised_2024.pdf | 2024-11-29 12:12 | 184K | |
![[ ]](/icons/layout.gif) | 2024 Programme Verification using JIRA.pdf | 2024-07-01 14:15 | 184K | |
![[ ]](/icons/unknown.gif) | Answer book request form.doc | 2023-12-05 09:50 | 186K | |
![[ ]](/icons/layout.gif) | Academic Calendars 25- 31.pdf | 2024-04-23 12:47 | 186K | |
![[IMG]](/icons/image2.gif) | Hannon_L.JPG | 2024-03-08 12:52 | 187K | |
![[ ]](/icons/layout.gif) | ReviewofRegistration2018Report_final.pdf | 2023-12-05 09:50 | 190K | |
![[ ]](/icons/unknown.gif) | Intern Examiner Nomination form 2020-1-1.doc | 2025-04-23 02:15 | 193K | |
![[ ]](/icons/unknown.gif) | Intern Examiner Nomination form 2020.doc | 2025-04-23 03:14 | 193K | |
![[ ]](/icons/layout.gif) | Module Access Management Checklist.pdf | 2023-12-05 09:50 | 193K | |
![[IMG]](/icons/image2.gif) | grid-darken.svg | 2024-03-08 12:52 | 194K | |
![[IMG]](/icons/image2.gif) | registry_cur.jpg | 2025-03-06 12:42 | 194K | |
![[ ]](/icons/unknown.gif) | Intern Examiner Nomination form 2020-1.doc | 2025-04-18 04:49 | 194K | |
![[ ]](/icons/layout.gif) | Spring Trimester, Resit Exam Registration.pdf | 2025-02-13 12:39 | 195K | |
![[IMG]](/icons/image2.gif) | Remediation Infographic.png | 2024-12-13 14:43 | 196K | |
![[IMG]](/icons/image2.gif) | UCD EXAM Staff structure (23.7 x 23.7 cm).jpg | 2024-03-08 12:52 | 197K | |
![[ ]](/icons/layout.gif) | rpl24_0321.pdf | 2023-12-05 09:50 | 201K | |
![[TXT]](/icons/text.gif) | canva_chart.js | 2023-12-05 09:50 | 203K | |
![[IMG]](/icons/image2.gif) | hero-1.png | 2024-03-08 12:52 | 206K | |
![[ ]](/icons/layout.gif) | UCD Directions Map to Shelbourne Hall - Updated Bus Route.pdf | 2025-04-24 13:13 | 207K | |
![[ ]](/icons/layout.gif) | 202324 Update - Module Descriptor - Edits to Reqs Prior Learning Places closing.pdf | 2024-03-08 12:52 | 209K | |
![[ ]](/icons/layout.gif) | How_to_use_SOAIDEN_in_Banner.pdf | 2025-02-13 14:09 | 214K | |
![[ ]](/icons/layout.gif) | List of completed eThesis enhancements 240822.pdf | 2023-12-05 09:50 | 216K | |
![[ ]](/icons/unknown.gif) | la-solid-900-1.ttf | 2024-03-08 12:52 | 221K | |
![[ ]](/icons/unknown.gif) | la-solid-900.ttf | 2025-02-20 15:43 | 221K | |
![[ ]](/icons/unknown.gif) | MCQ examination set-up form with guidelines 120922.doc | 2024-03-08 12:52 | 221K | |
![[ ]](/icons/unknown.gif) | la-solid-900-1.eot | 2024-03-08 12:52 | 221K | |
![[ ]](/icons/unknown.gif) | la-solid-900.eot | 2025-02-20 15:43 | 221K | |
![[ ]](/icons/layout.gif) | 2024_2025 HEA Data Collection Notice.pdf | 2024-08-13 14:15 | 222K | |
![[ ]](/icons/layout.gif) | Major Structure Review Checklist 202425.pdf | 2024-03-08 12:52 | 223K | |
![[ ]](/icons/layout.gif) | Major Structure Review Checklist .pdf | 2024-02-13 14:19 | 223K | |
![[ ]](/icons/unknown.gif) | MCQ examination set-up form with guidelines.doc | 2024-03-08 12:52 | 224K | |
![[ ]](/icons/layout.gif) | University College Dublin Mail - Ukraine Student Fees and Financial Support Update (August 2024).pdf | 2024-08-21 15:15 | 225K | |
![[ ]](/icons/layout.gif) | 2023_24 HEA Data Collection Notice.pdf | 2024-03-08 12:52 | 230K | |
![[ ]](/icons/unknown.gif) | Record of invigilation Hours for In-Semester Exams.docx | 2024-03-08 12:52 | 232K | |
![[ ]](/icons/layout.gif) | TSICSRV_Banner_Form_Fees_Info.pdf | 2024-03-08 12:52 | 233K | |
![[IMG]](/icons/image2.gif) | University Awards table-557x740.PNG | 2024-12-13 14:43 | 234K | |
![[IMG]](/icons/image2.gif) | Tunnel_L.JPG | 2024-03-08 12:52 | 235K | |
![[ ]](/icons/layout.gif) | How_to_use_SGAADVR_in_Banner.pdf | 2025-02-13 12:39 | 239K | |
![[IMG]](/icons/image2.gif) | grid-overlay-footer.png | 2024-03-08 12:52 | 240K | |
![[IMG]](/icons/image2.gif) | Tierney.jpg | 2024-03-08 12:52 | 240K | |
![[ ]](/icons/layout.gif) | Due-Diligence-and-Risk-Management_2019.pdf | 2024-03-08 12:52 | 242K | |
![[ ]](/icons/layout.gif) | Transcripts-Diploma-Supplements-Parchments-Conferring_2019.pdf | 2024-03-08 12:52 | 243K | |
![[IMG]](/icons/image2.gif) | canva_demo-parallax.jpg | 2023-12-05 09:50 | 246K | |
![[ ]](/icons/layout.gif) | Update_language_preference_in_browser.pdf | 2025-02-13 12:39 | 250K | |
![[ ]](/icons/layout.gif) | PDARF6 Structured Elective .pdf | 2024-02-12 11:53 | 250K | |
![[ ]](/icons/layout.gif) | UCD Directions Map to Simmonscourt - Updated Bus Route.pdf | 2025-04-24 13:13 | 250K | |
![[IMG]](/icons/image2.gif) | registry_group.jpg | 2024-03-08 12:52 | 253K | |
![[IMG]](/icons/image2.gif) | Joyce.JPG | 2024-03-08 12:52 | 253K | |
![[ ]](/icons/layout.gif) | SOAIDEN_Person Search_Banner_9.pdf | 2023-12-04 16:18 | 254K | |
![[ ]](/icons/layout.gif) | Collab Award Types, Taxonomies and Est Routes for Collab_Nov 2024.pdf | 2024-12-12 11:43 | 256K | |
![[ ]](/icons/layout.gif) | Formal Agreements_2024.pdf | 2025-01-23 21:12 | 264K | |
![[ ]](/icons/layout.gif) | Alternative Linear Conversion Grade Scale 60 per cent China only.pdf | 2025-04-08 10:44 | 265K | |
![[ ]](/icons/layout.gif) | SSASECT screen Banner .pdf | 2024-03-08 12:52 | 275K | |
![[ ]](/icons/layout.gif) | Appeals_form.pdf | 2024-03-08 12:52 | 284K | |
![[ ]](/icons/layout.gif) | Applicant_Privacy_Statement.pdf | 2024-03-08 12:52 | 286K | |
![[ ]](/icons/layout.gif) | Annual Monitoring and Periodic Review_2024.pdf | 2024-12-12 12:13 | 287K | |
![[ ]](/icons/layout.gif) | How_to_use_SFASTCA_in_Banner.pdf | 2025-02-13 13:10 | 289K | |
![[ ]](/icons/layout.gif) | How_to_use_TSICSRV.pdf | 2025-02-20 15:09 | 290K | |
![[TXT]](/icons/text.gif) | canva_style.css | 2023-12-05 09:50 | 293K | |
![[ ]](/icons/layout.gif) | Email to Staff - Assessment Email Contacts.pdf | 2025-01-14 16:13 | 293K | |
![[ ]](/icons/layout.gif) | How_to_log_into_Banner_Dec_2023.pdf | 2023-12-04 20:47 | 297K | |
![[ ]](/icons/layout.gif) | UCD_Student_Vetting_Policy_Nov_2018.pdf | 2023-12-05 09:50 | 300K | |
![[ ]](/icons/layout.gif) | External_Reporting.pdf | 2024-03-08 12:52 | 300K | |
![[ ]](/icons/layout.gif) | UCD_Registry_Registration_statuses_May2023.pdf | 2023-12-05 09:50 | 302K | |
![[ ]](/icons/layout.gif) | Transcripts-Diploma-Supplements-Parchments-Conferring_revised_2024.pdf | 2024-11-29 12:12 | 304K | |
![[ ]](/icons/layout.gif) | SFASTCA screen Banner 9.pdf | 2023-12-04 16:18 | 309K | |
![[ ]](/icons/layout.gif) | ReviewofRegistration2019Report_published.pdf | 2024-03-08 12:52 | 310K | |
![[ ]](/icons/layout.gif) | Draft Stage Reassignment guide Ver1 220621.pdf | 2023-12-05 09:50 | 313K | |
![[ ]](/icons/layout.gif) | 08_05_23curriculum_majors_closing.pdf | 2025-01-31 16:09 | 315K | |
![[ ]](/icons/layout.gif) | _Autumn Trimester Exams, Final Arrangements Staff .pdf | 2024-12-02 13:42 | 319K | |
![[ ]](/icons/layout.gif) | Drop_Add_modules_General_2023.pdf | 2023-12-05 09:50 | 320K | |
![[ ]](/icons/layout.gif) | Alternative Non-Linear Conversion Grade Scale 50 per cent Pass.pdf | 2025-04-08 10:44 | 320K | |
![[ ]](/icons/layout.gif) | Drop_Add_Modules_Spring_2022.pdf | 2023-12-05 09:50 | 321K | |
![[ ]](/icons/layout.gif) | 202324Update_ ModuleDescriptor_EditstoReqsPrior LearningPlacesClosing.pdf | 2025-03-24 09:44 | 322K | |
![[ ]](/icons/layout.gif) | How_to_run_degree_compliance_in_InfoHub.pdf | 2024-03-08 12:52 | 326K | |
![[ ]](/icons/layout.gif) | Drop_Add_Modules_Aut_2021.pdf | 2023-12-05 09:50 | 326K | |
![[ ]](/icons/layout.gif) | 202324 Curriculum Update for Module Coordinators - Late Changes to Requirements, Prior Learning, Module Access Management Amendments.pdf | 2024-03-08 12:52 | 329K | |
![[ ]](/icons/layout.gif) | Drop_Add_Modules_Spr_23-34.pdf | 2024-03-08 12:52 | 330K | |
![[ ]](/icons/layout.gif) | SPACMNT screen Banner 9.pdf | 2024-03-08 12:52 | 336K | |
![[ ]](/icons/layout.gif) | LC_Summary_ER_2022.pdf | 2023-12-05 09:50 | 348K | |
![[ ]](/icons/layout.gif) | MCQ Answer Sheet Marking Instructions and Error Types Guide.pdf | 2024-03-08 12:52 | 350K | |
![[ ]](/icons/layout.gif) | Drop_Add_Module_Spring_2021_archive.pdf | 2023-12-05 09:50 | 358K | |
![[ ]](/icons/layout.gif) | LC_Summary_ER_2023.pdf | 2023-12-05 09:50 | 361K | |
![[ ]](/icons/layout.gif) | Drop_Add_modules_Spring_2023.pdf | 2024-03-08 12:52 | 365K | |
![[IMG]](/icons/image2.gif) | science.jpg | 2023-12-04 14:20 | 372K | |
![[ ]](/icons/layout.gif) | LC_Summary_ER_2024.pdf | 2024-03-08 12:52 | 374K | |
![[ ]](/icons/layout.gif) | LC_Summary_ER_2025.pdf | 2024-09-24 17:45 | 374K | |
![[ ]](/icons/layout.gif) | How to Apply to UCD.pdf | 2024-10-01 16:46 | 380K | |
![[ ]](/icons/layout.gif) | UPB Local Approvals Flowchart.pdf | 2024-05-16 09:04 | 387K | |
![[ ]](/icons/layout.gif) | UPB Local Approvals Flowchart Apr 2025.pdf | 2025-04-10 11:13 | 388K | |
![[ ]](/icons/layout.gif) | Due Diligence and Risk Management_2019.pdf | 2024-10-25 17:16 | 391K | |
![[ ]](/icons/layout.gif) | Due Diligence and Risk Management_2024.pdf | 2024-12-12 12:13 | 391K | |
![[ ]](/icons/layout.gif) | 250924_Guidelines_for_Extern_Examiners_for_Taught_Programmes.pdf | 2024-09-25 15:45 | 394K | |
![[ ]](/icons/layout.gif) | 021024_Guidelines_for_Extern_Examiners_for_Taught_Programmes.pdf | 2024-10-02 14:47 | 395K | |
![[ ]](/icons/layout.gif) | UPB Local Approvals Flowchart-1.pdf | 2025-04-10 09:43 | 396K | |
![[ ]](/icons/layout.gif) | SGAADVR screen Banner 9.pdf | 2024-03-08 12:52 | 406K | |
![[ ]](/icons/layout.gif) | Drop_Add_email_doc_Aut_23.pdf | 2024-03-08 12:52 | 408K | |
![[IMG]](/icons/image2.gif) | 2111_Autumn_024a.jpg | 2024-03-08 12:52 | 411K | |
![[ ]](/icons/unknown.gif) | Excel sheet for manually calculating sub-components.xlsx | 2025-01-08 12:44 | 411K | |
![[ ]](/icons/layout.gif) | Annual_Monitoring_Periodic_Review.pdf | 2024-03-08 12:52 | 415K | |
![[ ]](/icons/layout.gif) | Drop_Add_modules_general.pdf | 2024-10-02 15:16 | 419K | |
![[ ]](/icons/layout.gif) | MAM user guide_HB_28.03.19.pdf | 2024-03-08 12:52 | 421K | |
![[IMG]](/icons/image2.gif) | canva_loader-image.gif | 2023-12-05 09:50 | 431K | |
![[ ]](/icons/layout.gif) | ACCE Meeting Dates 2023-24.pdf | 2024-03-08 12:52 | 444K | |
![[IMG]](/icons/image2.gif) | image_lake2023.jpg | 2025-01-29 13:12 | 445K | |
![[ ]](/icons/layout.gif) | 20230508Update_ModuleDescriptorEditsToReqsPriorLearningPlacesclosing.pdf | 2025-02-04 16:39 | 449K | |
![[ ]](/icons/layout.gif) | 202324Curriculum UpdateforModule Coordinators_ LateChangesto Requirements_ PriorLearning_ ModuleAccess Management Amendments.pdf | 2025-03-24 10:12 | 465K | |
![[ ]](/icons/layout.gif) | MAM-user-guide_HB_28.03.19.pdf | 2025-01-13 17:12 | 484K | |
![[ ]](/icons/layout.gif) | Module Access Management User Guide-1.pdf | 2025-01-13 09:42 | 484K | |
![[ ]](/icons/layout.gif) | Module_Access_Management_UserGuide-1.pdf | 2025-01-14 09:43 | 484K | |
![[ ]](/icons/layout.gif) | Module_Access_Management_guide.pdf | 2025-01-14 14:43 | 484K | |
![[ ]](/icons/layout.gif) | STAFF Spring End of Trimester Exams 2022_2023.pdf | 2024-03-08 12:52 | 489K | |
![[ ]](/icons/layout.gif) | 202324 Curriculum Management Update Arrangements for Edits to September-intake Majors & Modules.pdf | 2024-03-08 12:52 | 490K | |
![[ ]](/icons/unknown.gif) | SEB Request Template.xlsx | 2023-12-05 09:50 | 506K | |
![[ ]](/icons/layout.gif) | New Module Requests - 202425-1.pdf | 2025-01-13 10:12 | 509K | |
![[ ]](/icons/layout.gif) | Update_a_stage_for_a_module_via_InfoHub_2023.pdf | 2024-03-08 12:52 | 516K | |
![[ ]](/icons/layout.gif) | New Module Requests - 202425.pdf | 2024-03-08 12:52 | 525K | |
![[ ]](/icons/layout.gif) | Brightspace Quick Guide Extern Examiner Access-.pdf | 2024-03-08 12:52 | 526K | |
![[ ]](/icons/layout.gif) | 202324 Update for Schools-Colleges - Edits to Sept Intake Majors Closing.pdf | 2025-01-31 13:09 | 533K | |
![[ ]](/icons/layout.gif) | Review of Registration 2022.pdf | 2024-03-08 12:52 | 552K | |
![[IMG]](/icons/image2.gif) | canva_font-icons.svg | 2023-12-05 09:50 | 557K | |
![[ ]](/icons/layout.gif) | How to apply to UCD 2023.pdf | 2023-12-04 14:20 | 565K | |
![[ ]](/icons/layout.gif) | New Module Requests 202526 .pdf | 2025-02-10 12:39 | 570K | |
![[ ]](/icons/layout.gif) | New Module Requests.pdf | 2023-12-04 14:20 | 572K | |
![[TXT]](/icons/text.gif) | canva_plugins.js | 2023-12-05 09:50 | 583K | |
![[ ]](/icons/layout.gif) | Review of Registration 2020_published.pdf | 2024-03-08 12:52 | 593K | |
![[ ]](/icons/layout.gif) | eProctoring Project Report to UMT EG.pdf | 2025-01-16 11:12 | 600K | |
![[TXT]](/icons/text.gif) | main.min.css | 2025-02-20 15:43 | 602K | |
![[TXT]](/icons/text.gif) | main.min-1.css | 2025-03-19 09:44 | 602K | |
![[ ]](/icons/layout.gif) | Updated - Stage Reassignment Guide.pptx.pdf | 2024-12-13 14:43 | 607K | |
![[ ]](/icons/layout.gif) | Guidelines for Subject Extern Examiners.pdf | 2024-05-24 14:17 | 612K | |
![[ ]](/icons/layout.gif) | Guide for UCD Staff How to nominate Special Extern Examiners (1).pdf | 2024-03-08 12:52 | 619K | |
![[ ]](/icons/layout.gif) | Getting Paid.pdf | 2025-04-24 16:44 | 623K | |
![[ ]](/icons/layout.gif) | 6 Getting Paid.pptx.pdf | 2024-11-28 16:12 | 623K | |
![[ ]](/icons/layout.gif) | Review_of_Registration_ 2021_published.pdf | 2024-03-08 12:52 | 628K | |
![[ ]](/icons/layout.gif) | Guidelines for UCD Staff How Heads of Schools respond to Subject Extern Examiner reports.pdf | 2024-03-08 12:52 | 638K | |
![[ ]](/icons/layout.gif) | Compliance_report_available_in_InfoHub.pdf | 2023-12-05 09:50 | 639K | |
![[ ]](/icons/layout.gif) | Editing Majors User Guide 202425.pdf | 2024-03-08 12:52 | 652K | |
![[ ]](/icons/layout.gif) | Module List Management - 202425.pdf | 2024-06-04 11:17 | 653K | |
![[ ]](/icons/unknown.gif) | New Module Requests - 202425.pptx | 2024-02-13 18:18 | 657K | |
![[ ]](/icons/layout.gif) | Module List Management.pdf | 2023-12-04 14:20 | 658K | |
![[ ]](/icons/layout.gif) | 202324CMS_ UpdateArrangements_for_Editsto September_intake Majors_Modules.pdf | 2025-03-24 10:12 | 666K | |
![[ ]](/icons/layout.gif) | How-to-apply-to-UCD.pdf | 2023-12-05 09:50 | 666K | |
![[ ]](/icons/layout.gif) | How_to_find_CRN_and_timetabling_info_2022.pdf | 2024-03-08 12:52 | 673K | |
![[ ]](/icons/layout.gif) | Review_of_Registration_2023_report_final.pdf | 2024-03-08 12:52 | 677K | |
![[ ]](/icons/layout.gif) | Module List Management - 202425-1.pdf | 2025-01-13 10:12 | 709K | |
![[ ]](/icons/layout.gif) | Module List Management guide 202526 .pdf | 2025-02-10 11:40 | 715K | |
![[IMG]](/icons/image2.gif) | cherry.JPG | 2024-03-08 12:52 | 766K | |
![[ ]](/icons/layout.gif) | Answer sheet type 2 A-Z (up to 50Q) Code S3234.pdf | 2024-03-08 12:52 | 781K | |
![[ ]](/icons/layout.gif) | Uploading_Grades_Guide.pdf | 2025-04-01 11:44 | 782K | |
![[IMG]](/icons/image2.gif) | Kaylin Bednarz.jpg | 2024-09-27 09:15 | 789K | |
![[ ]](/icons/layout.gif) | 250924_How_to_Nominate_Extern_Examiners_for_Taught_Programmes.pdf | 2024-09-25 19:14 | 828K | |
![[ ]](/icons/layout.gif) | Editing Majors.pdf | 2023-12-05 09:50 | 831K | |
![[ ]](/icons/layout.gif) | Supervisor and Schools eThesis Exam system Guidebook v7 11012023.pdf | 2024-03-08 12:52 | 848K | |
![[ ]](/icons/layout.gif) | How to Nominate Subject Extern Examiners-in template-updated 11 Aug 20.pdf | 2024-03-08 12:52 | 866K | |
![[IMG]](/icons/image2.gif) | la-solid-900-1.svg | 2024-03-08 12:52 | 902K | |
![[IMG]](/icons/image2.gif) | la-solid-900.svg | 2025-02-20 15:43 | 902K | |
![[IMG]](/icons/image2.gif) | la-brands-400-1.svg | 2024-03-08 12:52 | 906K | |
![[IMG]](/icons/image2.gif) | la-brands-400.svg | 2025-02-20 15:43 | 906K | |
![[ ]](/icons/layout.gif) | Updated - Grade Transfer Guide.pptx.pdf | 2024-12-13 14:43 | 956K | |
![[ ]](/icons/layout.gif) | Exam Committee eThesis Exam system Guidebook Nov22.pdf | 2024-03-08 12:52 | 973K | |
![[ ]](/icons/layout.gif) | ACCE_Meeting_Dates_202425.pdf | 2024-08-26 14:15 | 1.0M | |
![[ ]](/icons/layout.gif) | How-to-guide_Manual-Registration_Banner_July_22.pdf | 2023-12-05 09:50 | 1.0M | |
![[ ]](/icons/layout.gif) | Editing Module Descriptors - 202425-1.pdf | 2025-02-24 10:39 | 1.0M | |
![[ ]](/icons/layout.gif) | How-to-use-the-staff-view-of-online-registration_2020.pdf | 2023-12-05 09:50 | 1.0M | |
![[ ]](/icons/layout.gif) | Editing Majors 202425.pdf | 2024-03-13 15:51 | 1.0M | |
![[ ]](/icons/layout.gif) | Exemptions_User_Guide.pdf | 2025-01-13 16:12 | 1.0M | |
![[ ]](/icons/layout.gif) | Exemptions User Guide.pdf | 2023-12-05 09:50 | 1.0M | |
![[ ]](/icons/layout.gif) | Editing Module Descriptors - 202425.pdf | 2024-03-08 12:52 | 1.1M | |
![[ ]](/icons/layout.gif) | Editing Majors 202425-1.pdf | 2025-01-13 09:42 | 1.1M | |
![[ ]](/icons/layout.gif) | Updated - Uploading Grades Guide.pptx.pdf | 2024-12-13 14:43 | 1.1M | |
![[ ]](/icons/layout.gif) | uploading_grades_guide.pdf | 2025-02-21 11:39 | 1.1M | |
![[ ]](/icons/layout.gif) | Editing Majors 202526 .pdf | 2025-02-10 11:09 | 1.1M | |
![[ ]](/icons/layout.gif) | Revised EGC System School_College User Guide 151221.pdf | 2023-12-05 09:50 | 1.1M | |
![[ ]](/icons/layout.gif) | Updated - Manual Grade Entry Guide.pptx.pdf | 2024-12-13 14:43 | 1.1M | |
![[ ]](/icons/layout.gif) | Updated - Programme Audit Reports.pptx.pdf | 2024-12-13 14:43 | 1.1M | |
![[ ]](/icons/layout.gif) | How to use the UCD applications system__final.pdf | 2024-08-27 10:45 | 1.2M | |
![[ ]](/icons/layout.gif) | How to_ Define your Teaching Arrangements method for the Spring Trimester.pdf | 2024-03-08 12:52 | 1.2M | |
![[ ]](/icons/unknown.gif) | Global Partnerships Proposal Form.docx | 2024-11-27 17:42 | 1.2M | |
![[ ]](/icons/layout.gif) | Data Protection.pdf | 2025-04-24 16:44 | 1.3M | |
![[ ]](/icons/layout.gif) | Extern Access to UCD Systems.pdf | 2024-03-08 12:52 | 1.3M | |
![[ ]](/icons/layout.gif) | Guide For UCD Staff - Assigning Externs to Modules.pdf | 2024-03-08 12:52 | 1.3M | |
![[ ]](/icons/layout.gif) | Guide for Assigning Subject Externs to Modules.pdf | 2024-05-27 13:17 | 1.3M | |
![[ ]](/icons/layout.gif) | Editing Module Descriptors guide 202526.pdf | 2025-02-11 08:39 | 1.3M | |
![[ ]](/icons/unknown.gif) | GPPF Template_Dec 2024.docx | 2024-12-19 12:44 | 1.3M | |
![[ ]](/icons/layout.gif) | 021024_Updated Guidelines for UCD Staff How Heads of Schools respond to Subject Extern Examiner reports.pdf | 2024-10-02 15:16 | 1.3M | |
![[ ]](/icons/layout.gif) | Editing Module Descriptors.pdf | 2023-12-05 09:50 | 1.4M | |
![[ ]](/icons/layout.gif) | 3 Data Protection.pptx.pdf | 2024-11-28 16:12 | 1.4M | |
![[ ]](/icons/layout.gif) | 250924_Guidelines_for_UCD_Staff_How_Heads_of_Schools_respond_to_Extern_Examiner_for_Taught_Programmes_reports.pdf | 2024-09-25 20:14 | 1.4M | |
![[ ]](/icons/layout.gif) | Updated - My Module Grades - Reports.pptx.pdf | 2024-12-13 14:43 | 1.5M | |
![[ ]](/icons/layout.gif) | Updated - Programme Exam Board Reporting.pptx.pdf | 2024-12-13 14:43 | 1.6M | |
![[ ]](/icons/layout.gif) | 4 Exam Venues.pptx.pdf | 2024-11-28 16:12 | 1.6M | |
![[ ]](/icons/layout.gif) | Updated - My Module Grades - Guide.pptx.pdf | 2024-12-13 14:43 | 1.7M | |
![[ ]](/icons/layout.gif) | Exam Venues.pdf | 2025-04-24 16:44 | 1.7M | |
![[ ]](/icons/layout.gif) | 2 Oct 06_Updated Guide For UCD Staff - Assigning Externs to Modules.pdf | 2024-10-02 14:47 | 1.8M | |
![[IMG]](/icons/image2.gif) | 2311_Brennan_S_012a (1).jpg | 2023-12-07 13:17 | 1.8M | |
![[ ]](/icons/layout.gif) | Updated - School Grading Summary.pptx.pdf | 2024-12-13 14:43 | 1.8M | |
![[ ]](/icons/layout.gif) | Introduction.pdf | 2025-04-24 16:43 | 1.8M | |
![[ ]](/icons/layout.gif) | Info session 17 Jul 23_Master.pdf | 2023-12-05 09:50 | 1.9M | |
![[ ]](/icons/layout.gif) | How-to-guide_Manual-Registration_Banner_Dec_23.pdf | 2024-03-08 12:52 | 2.0M | |
![[ ]](/icons/layout.gif) | 1 Introduction.pptx.pdf | 2024-11-28 16:12 | 2.0M | |
![[ ]](/icons/layout.gif) | Grade Entry Guidebook draft v.11.pdf | 2023-12-05 09:50 | 2.0M | |
![[ ]](/icons/layout.gif) | Info_session_15 July_2024.pdf | 2024-07-17 12:48 | 2.1M | |
![[ ]](/icons/layout.gif) | 5 Exam Hall Procedures.pptx.pdf | 2024-11-28 16:12 | 2.5M | |
![[ ]](/icons/layout.gif) | Exam Hall Procedures.pdf | 2025-04-24 16:44 | 2.5M | |
![[ ]](/icons/layout.gif) | 25_09_24_Guide_for_Extern_Examiners_for_Taught_Programmes_how_to_get_access_ to_UCD_Systems.pdf | 2024-09-25 15:45 | 2.8M | |
![[IMG]](/icons/image2.gif) | Screenshot 2024-02-09 at 11.52.31.png | 2024-03-08 12:52 | 2.8M | |
![[IMG]](/icons/image2.gif) | 20250221_105641 (1) Michelle Photos .jpg | 2025-03-24 15:44 | 2.9M | |
![[ ]](/icons/layout.gif) | Retention1999-2001.pdf | 2023-12-05 09:50 | 2.9M | |
![[ ]](/icons/layout.gif) | Grade Entry Guidebook draft v.12.pdf | 2024-03-08 12:52 | 2.9M | |
![[ ]](/icons/layout.gif) | Registry_Guide_Jan_ 2024.pdf | 2024-03-08 12:52 | 3.4M | |
![[ ]](/icons/layout.gif) | Registry_Guide_May_ 2024.pdf | 2024-05-28 15:17 | 3.4M | |
![[ ]](/icons/layout.gif) | Registry_Guide_Nov_ 2023.pdf | 2023-12-04 14:20 | 3.6M | |
![[ ]](/icons/layout.gif) | retention2008.pdf | 2023-12-05 09:50 | 5.7M | |
![[IMG]](/icons/image2.gif) | UCD_Panorama_L.jpg | 2024-03-08 12:52 | 13M | |
![[VID]](/icons/movie.gif) | 2 Dignity and Respect (1).mp4 | 2024-11-28 16:12 | 80M | |
|